10374-80-8
Dimethyl 4,4´-stilbenedicarboxylate
CAS: 10374-80-8
Molecular Formula: C18H16O4
10374-80-8 - Names and Identifiers
| Name | Dimethyl 4,4´ -stilbenedicarboxylate |
| Synonyms | -stilbenedicarboxylate Dimethyl 4,4-stilbenedicarboxylate Dimethyl stilbene-4,4'-dicarboxylate Stilbenedicarboxylic Acid Dimethy Ester dimethyl 4,4'-(E)-ethene-1,2-diyldibenzoate Stilbene-4,4'-dicarboxylic acid dimethyl ester 4,4'-(Ethene-1,2-diyl)bis(benzoic acid methyl) ester Benzoic acid, 4,4'-(1,2-ethenediyl)bis-, 1,1'-dimethyl ester |
| CAS | 10374-80-8 |
| InChI | InChI=1/C18H16O4/c1-21-17(19)15-9-5-13(6-10-15)3-4-14-7-11-16(12-8-14)18(20)22-2/h3-12H,1-2H3/b4-3+ |
10374-80-8 - Physico-chemical Properties
| Molecular Formula | C18H16O4 |
| Molar Mass | 296.32 |
| Density | 1.192g/cm3 |
| Boling Point | 448.3°C at 760 mmHg |
| Flash Point | 226.3°C |
| Vapor Presure | 3.14E-08mmHg at 25°C |
| Refractive Index | 1.619 |
10374-80-8 - Introduction
Dimethyl oxalate is an organic compound with the chemical formula (HOOC)2C(CH3)2. Here are the details about it:
Nature:
1. appearance: colorless liquid.
2. smell: with unpleasant pungent smell.
3. density: about 1.14 g/cm.
4. Melting point: about -7°C.
5. Boiling point: about 206°C.
6. Solubility: Soluble in common organic solvents such as ethanol, acetone and dichloromethane.
Use:
1. in chemical synthesis: dimethyl acid is often used as an intermediate in organic synthesis, for the preparation of plant growth regulators and pesticides.
2. Surface treatment agent: Dimethyl oxalate can be used as a surface treatment agent for certain plastics to improve their surface properties and durability.
3. Solvent: Due to its good solubility, dimethyl oxalate can be used as a solvent and play a role in some applications in chemical experiments or industrial production.
Preparation Method:
Dimethyl oxalate is typically formed by reacting dimethyl adipic acid with an excess of phthalic acid.
Safety Information:
1. the two methyl ester is an irritating substance, and it is necessary to pay attention to protective measures when using it, such as wearing protective gloves, goggles and protective clothing.
2. Avoid contact with the skin, eyes and respiratory system.
3. in use and storage, please keep away from high temperature and fire.
4. Dimethyl oxalate should be kept away from children and pets, stored in an airtight container, and placed in a well-ventilated place.
5. in the process of operation, must follow the correct chemical laboratory operating specifications and safe operating procedures. If you are not sure how to use it, please consult a chemical expert or relevant agency.
Nature:
1. appearance: colorless liquid.
2. smell: with unpleasant pungent smell.
3. density: about 1.14 g/cm.
4. Melting point: about -7°C.
5. Boiling point: about 206°C.
6. Solubility: Soluble in common organic solvents such as ethanol, acetone and dichloromethane.
Use:
1. in chemical synthesis: dimethyl acid is often used as an intermediate in organic synthesis, for the preparation of plant growth regulators and pesticides.
2. Surface treatment agent: Dimethyl oxalate can be used as a surface treatment agent for certain plastics to improve their surface properties and durability.
3. Solvent: Due to its good solubility, dimethyl oxalate can be used as a solvent and play a role in some applications in chemical experiments or industrial production.
Preparation Method:
Dimethyl oxalate is typically formed by reacting dimethyl adipic acid with an excess of phthalic acid.
Safety Information:
1. the two methyl ester is an irritating substance, and it is necessary to pay attention to protective measures when using it, such as wearing protective gloves, goggles and protective clothing.
2. Avoid contact with the skin, eyes and respiratory system.
3. in use and storage, please keep away from high temperature and fire.
4. Dimethyl oxalate should be kept away from children and pets, stored in an airtight container, and placed in a well-ventilated place.
5. in the process of operation, must follow the correct chemical laboratory operating specifications and safe operating procedures. If you are not sure how to use it, please consult a chemical expert or relevant agency.
Last Update：2024-04-10 22:29:15
