104018-07-7
Buflomedil pyridoxal phosphate
CAS: 104018-07-7
Molecular Formula: C25H35N2O10P
104018-07-7 - Names and Identifiers
| Name | Buflomedil pyridoxal phosphate |
| Synonyms | Buflomedil pyridoxal phosphate (4-Formyl-5-hydroxy-6-methylpyridin-3-yl)methyl dihydrogen phosphate 4-pyrrolidin-1-yl-1-(2,4,6-trimethoxyphenyl)butan-1-one |
| CAS | 104018-07-7 |
| EINECS | 201-215-5 |
| InChI | InChI=1/C17H25NO4.C8H10NO6P/c1-20-13-11-15(21-2)17(16(12-13)22-3)14(19)7-6-10-18-8-4-5-9-18;1-5-8(11)7(3-10)6(2-9-5)4-15-16(12,13)14/h11-12H,4-10H2,1-3H3;2-3,11H,4H2,1H3,(H2,12,13,14) |
104018-07-7 - Physico-chemical Properties
| Molecular Formula | C25H35N2O10P |
| Molar Mass | 554.53 |
| Boling Point | 454.5°C at 760 mmHg |
| Flash Point | 228.7°C |
| Vapor Presure | 1.9E-08mmHg at 25°C |
104018-07-7 - Introduction
Buflomedil pyridoxal phosphate is a chemical substance whose chemical formula is C11H16NO10P. The following is a description of the properties, uses, preparation and safety information of buflomedil pyridoxal phosphate:
Nature:
1. pyridoxal buflomedil phosphate is a colorless to slightly yellow crystal or crystalline powder.
2. It has good solubility in water and is soluble in organic solvents such as ethanol, ether and chloroform.
3. pyridoxal buflomedil phosphate is acidic and can form compounds such as salts and esters.
Use:
1. Buflomedil pyridoxal phosphate is widely used in the preparation of synthetic drugs and pharmaceutical intermediates in the pharmaceutical field.
2. It can also be used as a complexing agent, chelating agent and antioxidant.
Preparation Method:
The preparation of buflomedil pyridoxal phosphate can be carried out by the following steps:
1. Amidation reaction of aniline and chloroacetic acid to generate N-(2-chloroacetyl) aniline.
2. reacting N-(2-chloroacetyl) aniline with phosphorus oxychloride to generate 4-(dichlorophosphoryl) aniline.
3. 4-(dichlorophosphoryl) aniline reacts with pyridoxal to generate pyridoxal buflomedil phosphate.
Safety Information:
1. pyridoxal buflomedil phosphate should be away from fire and heat sources, avoid contact with oxidants and combustibles.
2. in the use of the process should pay attention to prevent direct contact with the skin, eyes and respiratory tract.
3. if accidental contact or inhalation, please promptly rinse with plenty of water, and seek medical help.
4. in the storage process should be sealed, away from acid, alkali and other substances.
Nature:
1. pyridoxal buflomedil phosphate is a colorless to slightly yellow crystal or crystalline powder.
2. It has good solubility in water and is soluble in organic solvents such as ethanol, ether and chloroform.
3. pyridoxal buflomedil phosphate is acidic and can form compounds such as salts and esters.
Use:
1. Buflomedil pyridoxal phosphate is widely used in the preparation of synthetic drugs and pharmaceutical intermediates in the pharmaceutical field.
2. It can also be used as a complexing agent, chelating agent and antioxidant.
Preparation Method:
The preparation of buflomedil pyridoxal phosphate can be carried out by the following steps:
1. Amidation reaction of aniline and chloroacetic acid to generate N-(2-chloroacetyl) aniline.
2. reacting N-(2-chloroacetyl) aniline with phosphorus oxychloride to generate 4-(dichlorophosphoryl) aniline.
3. 4-(dichlorophosphoryl) aniline reacts with pyridoxal to generate pyridoxal buflomedil phosphate.
Safety Information:
1. pyridoxal buflomedil phosphate should be away from fire and heat sources, avoid contact with oxidants and combustibles.
2. in the use of the process should pay attention to prevent direct contact with the skin, eyes and respiratory tract.
3. if accidental contact or inhalation, please promptly rinse with plenty of water, and seek medical help.
4. in the storage process should be sealed, away from acid, alkali and other substances.
Last Update：2024-04-09 15:17:50
