106982-77-8 - Names and Identifiers
Name | 9-fluoroenylmethoxycarbonylpyroglutamate
|
Synonyms | 9-Femcp N-Fmoc-5-oxo-L-proline N-FMoc-5-oxo-L-proline Fmoc-L-Pyroglutamic acid 9-Fluoroenylmethoxycarbonylpyroglutamate 9-fluoroenylmethoxycarbonylpyroglutamate N-9-Fluorenylmethoxycarbonylpyroglutamate 1-[(9H-fluoren-9-ylmethoxy)carbonyl]-5-oxo-L-proline (S)-1-(9H-Fluoren-9-ylmethyl) 5-oxo-1,2-pyrrolidinedicarboxylate (2S)-1-(9H-fluoren-9-ylmethoxycarbonyl)-5-oxopyrrolidine-2-carboxylicaci (S)-1-(((9H-fluoren-9-yl)methoxy)carbonyl)-5-oxopyrrolidine-2-carboxylic acid (2S)-1-{[(9H-fluoren-9-yl)methoxy]carbonyl}-5-oxopyrrolidine-2-carboxylic acid 1,2-Pyrrolidinedicarboxylic acid, 5-oxo-, 1-(9H-fluoren-9-ylmethyl) ester, (S)- 1,2-Pyrrolidinedicarboxylic acid, 5-oxo-, 1-(9H-fluoren-9-ylmethyl) ester, (2S)-
|
CAS | 106982-77-8
|
InChI | InChI=1/C20H17NO5/c22-18-10-9-17(19(23)24)21(18)20(25)26-11-16-14-7-3-1-5-12(14)13-6-2-4-8-15(13)16/h1-8,16-17H,9-11H2,(H,23,24)/t17-/m0/s1 |
106982-77-8 - Physico-chemical Properties
Molecular Formula | C20H17NO5
|
Molar Mass | 351.35 |
Density | 1.402g/cm3 |
Boling Point | 627.8°C at 760 mmHg |
Flash Point | 333.5°C |
Vapor Presure | 1.26E-16mmHg at 25°C |
Refractive Index | 1.646 |
106982-77-8 - Introduction
N-Fmoc-L-Pyroglutamic acid is an organic compound with the following properties:
1. Appearance: white crystalline solid
2. molecular formula: C26H22N2O6
3. Molecular weight: 454.46g/mol
4. melting point: 156-158 ℃
5. solubility: slightly soluble in water, soluble in some organic solvents such as dimethyl sulfoxide and dimethylformamide
N-Fmoc-L-pyroglutamic acid is mainly used for peptide synthesis in solid phase synthesis. It is often used as a protecting group for peptide synthesis to prevent non-specific reactions of amino acids with other reactants. During peptide synthesis, N-Fmoc-L-pyroglutamic acid can also be used to synthesize aspartic acid and glutamic acid.
The preparation method of N-Fmoc-L-pyroglutamic acid is relatively simple, and a common method is obtained by combining N-substituted pyroglutamic acid with L-pyroglutamic acid. The specific preparation method can refer to the relevant literature or buy the prepared compound from the chemical reagent dealer.
Regarding safety information, N-Fmoc-L-pyroglutamic acid is a common laboratory reagent and generally has low toxicity. However, it is still necessary to take appropriate safety measures, such as wearing laboratory regular protective equipment (such as laboratory gloves and glasses), avoiding contact with skin and eyes, and operating under well-ventilated conditions. Before use, it is recommended to read the relevant safety data sheets and operating instructions carefully.
Last Update:2024-04-10 22:29:15