108647-88-7

108647-88-7 - Names and Identifiers

Name	Methyl-2-deoxy-D-erythropentofuranoside dibenzoate
Synonyms	Methyl-2-deoxy-D-erythro pentofuranoside Methyl 2-Deoxy-D-ribofuranoside Dibenzoate 1-Methoxy-2-deoxy-3,5-di-O-benzoylribofuranose Methyl 2-deoxy-3,5-di-O-benzoyl-D-ribofuranoside Methyl-2-deoxy-D-erythropentofuranoside dibenzoate METHYL-2-DEOXY-D-ERYTHRO-PENTOFURANOSIDE DIBENZOATE METHYL-2-DEOXY-3,5-DI-O-BENZOYL-D-ERYTHRO-PENTOFURANOSIDE D-erythro-Pentofuranoside, methyl 2-deoxy-, dibenzoate (9CI) ((2R,3S)-3-(Benzoyloxy)-5-methoxytetrahydrofuran-2-yl)methyl benzoate
CAS	108647-88-7
InChI	InChI=1/2C7H6O2.C6H11O4/c28-7(9)6-4-2-1-3-5-6;1-9-4-2-6(8)10-5(4)3-7/h21-5H,(H,8,9);4-7H,2-3H2,1H3/q;;-1/p-2/t;;4-,5+,6?/m..0/s1

108647-88-7 - Physico-chemical Properties

Molecular Formula	C20H20O6
Molar Mass	356.37
Density	1.26±0.1 g/cm3(Predicted)
Boling Point	479.1±45.0 °C(Predicted)
Solubility	Chloroform, Dichloromethane, Ethyl Acetate, Methanol
Appearance	Colourless Solid (Gel)

108647-88-7 - Introduction

Methyl-2-deoxy-D-erythrofuranose dibenzoate, also known as MDP-2-P, is an organic compound. Its chemical structure includes a methyl group, a dibenzoate group, and a erythro-pentofuranosyl group.

This compound has the following properties:
1. Appearance: colorless to yellowish crystal or powder.
2. melting point: about 105-107 ℃.
3. Solubility: Soluble in organic solvents such as methanol, ethanol and chloroform, insoluble in water.

MDP-2-P have some major applications:
1. Chemical and pharmaceutical synthesis: As a synthetic intermediate, it can be used to synthesize other organic compounds, such as drugs, dyes and fragrances.
2. Biological research: As a non-natural carbohydrate, it can be used in the study of sugar metabolism pathways, enzyme catalytic reactions and biomarkers.

The preparation method of MDP-2-P can generally be synthesized by methylation and esterification. The specific preparation method can refer to the relevant literature or consult chemical professionals.

When using and handling MDP-2-P, you need to pay attention to the following safety information:
1. Avoid contact with skin and eyes. If exposed, rinse immediately with plenty of water and seek medical help.
2. avoid inhalation of gas or dust. Adequate ventilation shall be provided during operation.
3. Avoid contact with oxidants and strong acids during storage to avoid the risk of fire or explosion.
4. in the use and disposal, should comply with the local safety procedures and regulations.

Please note that the above information is for reference only. Please always pay attention to safety when using and handling chemicals, and refer to reliable chemical information and professional advice.

Last Update：2024-04-09 19:05:44