109480-78-6
N-methoxy-N-methylbutanamide
CAS: 109480-78-6
Molecular Formula: C6H13NO2
109480-78-6 - Names and Identifiers
| Name | N-methoxy-N-methylbutanamide |
| Synonyms | N-methoxy-N-methylbutanamide N-Methoxy-N-methylbutyramide N-Methoxy-N-methylbutanamide Butanamide, N-methoxy-N-methyl- N-Methoxy-N-Methyl-n-butylaMide |
| CAS | 109480-78-6 |
| InChI | InChI=1S/C6H13NO2/c1-4-5-6(8)7(2)9-3/h4-5H2,1-3H3 |
109480-78-6 - Physico-chemical Properties
| Molecular Formula | C6H13NO2 |
| Molar Mass | 131.17 |
| Density | 0.948±0.06 g/cm3(Predicted) |
| Boling Point | 144.1±23.0 °C(Predicted) |
| Solubility | Chloroform, Methanol (Slightly) |
| Appearance | Oil |
| Color | Colourless |
| Storage Condition | Hygroscopic, Refrigerator, under inert atmosphere |
| Stability | Moisture Sensitive |
| Refractive Index | 1.4300 to 1.4340 |
109480-78-6 - Introduction
N-Methoxy-N-methylbutanamide, the chemical formula C6H13NO2, is also known as N-Methyl-N-(methoxyethyl)acetamide, abbreviated MMEA. The following is a description of its nature, use, formulation and safety information:
Nature:
1. appearance: colorless liquid.
2. Molecular weight: 131.17g/mol.
3. Melting point:-30°C.
4. Boiling point: 222°C.
5. density: 0.997g/cm³.
6. Solubility: Soluble in water and many organic solvents.
Use:
1. MMEA can be used as a solvent to dissolve and catalyze reactants in organic synthesis reactions.
2. It can be used as a synthetic intermediate for certain drugs.
3. MMEA can also be used as a monomer and crosslinking agent when preparing polymers and coating materials.
Preparation Method:
The preparation method of MMEA can be realized by the following steps:
1. Mix butanone and methanol in molar proportions.
2. Add a certain amount of acetic acid and alkali catalyst to the mixture.
3. The reaction is carried out under certain reaction time and conditions.
4. Extract the target product, and obtain pure N-methoxy-N-methylbutanamide through subsequent distillation and purification steps.
Safety Information:
1. MMEA is an irritant. Please be careful to avoid contact with skin and eyes. If there is contact, immediately rinse the relevant area with plenty of water and seek medical advice.
2. In the use and handling of MMEA, should wear protective gloves, wear protective glasses and wear appropriate protective clothing.
3. Avoid inhaling MMEA vapor. If inhaling too much, transfer the personnel to a well-ventilated place in time.
4. MMEA should be stored in a sealed container, away from fire and oxidant.
5. When using or storing MMEA, please refer to the relevant safety data sheets and operating instructions to ensure safe use. Disposal of spills and waste in a timely manner and in accordance with local regulations.
Nature:
1. appearance: colorless liquid.
2. Molecular weight: 131.17g/mol.
3. Melting point:-30°C.
4. Boiling point: 222°C.
5. density: 0.997g/cm³.
6. Solubility: Soluble in water and many organic solvents.
Use:
1. MMEA can be used as a solvent to dissolve and catalyze reactants in organic synthesis reactions.
2. It can be used as a synthetic intermediate for certain drugs.
3. MMEA can also be used as a monomer and crosslinking agent when preparing polymers and coating materials.
Preparation Method:
The preparation method of MMEA can be realized by the following steps:
1. Mix butanone and methanol in molar proportions.
2. Add a certain amount of acetic acid and alkali catalyst to the mixture.
3. The reaction is carried out under certain reaction time and conditions.
4. Extract the target product, and obtain pure N-methoxy-N-methylbutanamide through subsequent distillation and purification steps.
Safety Information:
1. MMEA is an irritant. Please be careful to avoid contact with skin and eyes. If there is contact, immediately rinse the relevant area with plenty of water and seek medical advice.
2. In the use and handling of MMEA, should wear protective gloves, wear protective glasses and wear appropriate protective clothing.
3. Avoid inhaling MMEA vapor. If inhaling too much, transfer the personnel to a well-ventilated place in time.
4. MMEA should be stored in a sealed container, away from fire and oxidant.
5. When using or storing MMEA, please refer to the relevant safety data sheets and operating instructions to ensure safe use. Disposal of spills and waste in a timely manner and in accordance with local regulations.
Last Update：2024-04-09 15:17:50
Supplier List
Product Name: N-Methoxy-N-methylbutanamide Visit Supplier Webpage Request for quotation
CAS: 109480-78-6
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 109480-78-6
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: N-Methoxy-N-methylbutanamide Visit Supplier Webpage Request for quotation
CAS: 109480-78-6
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 109480-78-6
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History