116753-54-9

116753-54-9 - Names and Identifiers

Name	3-(4-fluorophenoxy)propan-1-amine
Synonyms	3-(4-fluorophenoxy)propan-1-amine 3-(4-Fluorophenoxy)propan-1-amine 1-PropanaMine,3-(4-fluorophenoxy)- 1-(3-aMinopropoxy)-4-fluorobenzene 1-Propanamine, 3-(4-fluorophenoxy)-
CAS	116753-54-9
InChI	InChI=1/C9H12FNO/c10-8-2-4-9(5-3-8)12-7-1-6-11/h2-5H,1,6-7,11H2

116753-54-9 - Physico-chemical Properties

Molecular Formula	C9H12FNO
Molar Mass	169.2
Density	1.096±0.06 g/cm3(Predicted)
Boling Point	269.1±20.0 °C(Predicted)
Flash Point	116.577°C
Vapor Presure	0.007mmHg at 25°C
pKa	10.71±0.10(Predicted)
Storage Condition	2-8°C
Refractive Index	1.504

116753-54-9 - Risk and Safety

Hazard Class

IRRITANT

116753-54-9 - Introduction

3-(4-fluorophenoxy) propylamine, also known as FPEA, is a chemical substance whose chemical formula is C9H12FNO. The following is about 3-(4-fluorophenoxy) propylamine properties, uses, preparation and safety information introduction.

Nature:
1. Appearance: 3-(4-fluorophenoxy) propylamine exists in the form of a colorless to slightly yellow liquid.
2. Solubility: It can be dissolved with many organic solvents such as alcohols, ethers and ketones.
3. Melting point and boiling point: The melting point of 3-(4-fluorophenoxy) propylamine is about -37°C, and the boiling point is about 212-214°C.
4. Toxicity: This compound should be considered toxic and should be used with caution.

Use:
1. pharmaceutical field: 3-(4-fluorophenoxy) propylamine in the pharmaceutical field is mainly used for the synthesis of drug intermediates, such as the synthesis of anti-cancer drug intermediates.
2. Pesticide field: It is also used to synthesize some pesticide intermediates, such as pesticides.
3. Others: Because of its active group, 3-(4-fluorophenoxy) propylamine can also act as a reagent in other organic synthesis reactions.

Preparation Method:
3-(4-fluorophenoxy) propylamine can be prepared by esterification of 3-aminopropanol with 4-fluorophenol.

Safety Information:
1. 3-(4-fluorophenoxy) propylamine is an organic compound, which has certain toxicity and should be used with caution.
2. during operation and storage, contact with strong oxidants and strong acids should be avoided to prevent dangerous reactions.
3. Wear appropriate personal protective equipment, such as gloves, protective glasses, etc.
4. When using or disposing of 3-(4-fluorophenoxy) propylamine, follow local laws, regulations and safety procedures.

Last Update：2024-04-09 21:04:16