122799-95-5
3-amino-1-ethyl-1H-pyrazole-4-carbonitrile
CAS: 122799-95-5;122799-95-9
Molecular Formula: C6H8N4
122799-95-5 - Names and Identifiers
| Name | 3-amino-1-ethyl-1H-pyrazole-4-carbonitrile |
| Synonyms | LogP 3-amino-1-ethylpyrazole-4-carbonitrile 3-amino-1-ethyl-1H-pyrazole-4-carbonitrile 3-AMINO-1-ETHYL-1H-PYRAZOLE-4-CARBONITRILE 1H-pyrazole-4-carbonitrile, 3-amino-1-ethyl- |
| CAS | 122799-95-5 122799-95-9 |
| InChI | InChI=1/C6H8N4/c1-2-10-4-5(3-7)6(8)9-10/h4H,2H2,1H3,(H2,8,9) |
122799-95-5 - Physico-chemical Properties
| Molecular Formula | C6H8N4 |
| Molar Mass | 136.15 |
| Density | 1.25 |
| Melting Point | 68℃ |
| Boling Point | 330.068°C at 760 mmHg |
| Flash Point | 153.42°C |
| Vapor Presure | 0mmHg at 25°C |
| Refractive Index | 1.623 |
122799-95-5 - Introduction
3-Amino-1-ethyl-4-cyanopyrazole (3-amino-1-ethyl-4-cyano pyrazole) is an organic compound with the following properties:
1. appearance: amino -1-ethyl -4-cyanopyrazole is white crystal or crystalline powder.
2. Solubility: It is soluble in organic solvents such as alcohol, ethanol and chloroform.
3. melting point: its melting point range is 90-94 ℃.
4. Chemical properties: The compound is a basic compound that can undergo hydrogen bonding and protonation reactions of nitrogen atoms. It also has a certain stability and is not easy to degrade. It can also be functionalized by a series of chemical reactions to produce derivatives with different properties.
The main uses of 3-amino-1-ethyl-4-cyanopyrazole include:
1. Anti-scorch insect: This compound has anti-scorch insect activity and can be used in the agricultural field to control various pests.
2. Pharmaceutical intermediates: It can also be used as intermediates for pesticides and pharmaceutical products to synthesize biologically active molecules.
The preparation method of 3-amino-1-ethyl-4-cyanopyrazole can be carried out by the following steps:
1. Reaction of 4,4 '-diaminoxylene with ethyl acetoacetate to give 1-ethylpyrazole.
2. Condensation reaction of 1-ethyl pyrazole with benzaldehyde to generate 1-ethyl -4-benzaldehyde pyrazole.
3.1-ethyl -4-benzaldehyde pyrazole is reacted with sodium cyanide to generate 3-amino -1-ethyl -4-cyanopyrazole.
When using 3-amino-1-ethyl-4-cyanopyrazole, please note the following safety information:
1. For any chemical, pay attention to laboratory safety procedures and wear appropriate personal protective equipment, such as laboratory gloves and goggles.
2. 3-Amino-1-ethyl-4-cyanopyrazole is an organic compound, which may cause certain toxicity and irritation to human body. Therefore, avoid exposure to skin and eyes during handling and use.
3. The compound should be kept dry and stored in a sealed container to avoid contact with air or moisture.
4. Even when used in small quantities, it should be ensured that the operation is carried out in a well-ventilated place to avoid inhalation or swallowing.
Before using 3-amino-1-ethyl-4-cyanopyrazole or performing any chemical experiments, please read and follow the relevant safety instructions and the safety data sheet (MSDS) provided by the manufacturer.
1. appearance: amino -1-ethyl -4-cyanopyrazole is white crystal or crystalline powder.
2. Solubility: It is soluble in organic solvents such as alcohol, ethanol and chloroform.
3. melting point: its melting point range is 90-94 ℃.
4. Chemical properties: The compound is a basic compound that can undergo hydrogen bonding and protonation reactions of nitrogen atoms. It also has a certain stability and is not easy to degrade. It can also be functionalized by a series of chemical reactions to produce derivatives with different properties.
The main uses of 3-amino-1-ethyl-4-cyanopyrazole include:
1. Anti-scorch insect: This compound has anti-scorch insect activity and can be used in the agricultural field to control various pests.
2. Pharmaceutical intermediates: It can also be used as intermediates for pesticides and pharmaceutical products to synthesize biologically active molecules.
The preparation method of 3-amino-1-ethyl-4-cyanopyrazole can be carried out by the following steps:
1. Reaction of 4,4 '-diaminoxylene with ethyl acetoacetate to give 1-ethylpyrazole.
2. Condensation reaction of 1-ethyl pyrazole with benzaldehyde to generate 1-ethyl -4-benzaldehyde pyrazole.
3.1-ethyl -4-benzaldehyde pyrazole is reacted with sodium cyanide to generate 3-amino -1-ethyl -4-cyanopyrazole.
When using 3-amino-1-ethyl-4-cyanopyrazole, please note the following safety information:
1. For any chemical, pay attention to laboratory safety procedures and wear appropriate personal protective equipment, such as laboratory gloves and goggles.
2. 3-Amino-1-ethyl-4-cyanopyrazole is an organic compound, which may cause certain toxicity and irritation to human body. Therefore, avoid exposure to skin and eyes during handling and use.
3. The compound should be kept dry and stored in a sealed container to avoid contact with air or moisture.
4. Even when used in small quantities, it should be ensured that the operation is carried out in a well-ventilated place to avoid inhalation or swallowing.
Before using 3-amino-1-ethyl-4-cyanopyrazole or performing any chemical experiments, please read and follow the relevant safety instructions and the safety data sheet (MSDS) provided by the manufacturer.
Last Update：2024-04-09 20:48:19
