126937-43-7 - Names and Identifiers
Name | PIPERAZINE-1,2-DICARBOXYLIC ACID 1-BENZYL ESTER 2-METHYL ESTER
|
Synonyms | 1-Cbz-piperazine-2-carboxylic acid Methylester 1-benzyl 2-methyl piperazine-1,2-dicarboxylate Methyl piperazine-2-carboxylate, N1-CBZ protected 1-N-CBZ-PIPERAZINE-2-CARBOXYLIC ACID METHYL ESTER Piperazine-2-carboxylic acid methyl ester, N1-CBZ protected PIPERAZINE-1,2-DICARBOXYLIC ACID 1-BENZYL ESTER 2-METHYL ESTER 1,2-Piperazinedicarboxylic acid, 2-methyl 1-(phenylmethyl) ester
|
CAS | 126937-43-7
|
InChI | InChI=1/C14H18N2O4/c1-19-13(17)12-9-15-7-8-16(12)14(18)20-10-11-5-3-2-4-6-11/h2-6,12,15H,7-10H2,1H3 |
126937-43-7 - Physico-chemical Properties
Molecular Formula | C14H18N2O4
|
Molar Mass | 278.3 |
Density | 1.213g/cm3 |
Boling Point | 406.529°C at 760 mmHg |
Flash Point | 199.662°C |
Vapor Presure | 0mmHg at 25°C |
Storage Condition | under inert gas (nitrogen or Argon) at 2–8 °C |
Refractive Index | 1.538 |
126937-43-7 - Introduction
1-N-benzyloxycarbonylpiperazine-2-carboxylic acid methyl ester is an organic compound with the following properties:
1. Appearance: colorless liquid at room temperature.
2. molecular formula: C15H18N2O3.
3. melting point: about 95-100 degrees Celsius.
4. Boiling point: about 310-315 degrees Celsius.
5. Solubility: Soluble in organic solvents such as ethanol, dimethyl sulfoxide, etc.
The main uses of this compound include:
1. synthetic drugs: can be used as drug intermediates, plays an important role in the pharmaceutical field.
2. chemical research: can be used for the synthesis of other organic compounds, such as amino acids, peptides and so on.
3. pesticide: has potential application value in the field of plant protection.
Preparation Method:
The preparation of 1-N-benzyloxycarbonylpiperazine-2-carboxylic acid methyl ester is usually carried out by carbonyl chemical reaction. The specific step is to react benzylamine with methyl formate under appropriate reaction conditions to generate the target product.
Safety Information:
1-N-benzyloxycarbonylpiperazine-2-carboxylic acid methyl ester is an organic compound. The following safety precautions should be paid attention to during use:
1. avoid contact with skin and eyes, avoid inhaling its vapor.
2. during use, protective glasses and gloves should be used.
3. must be operated in a well-ventilated environment.
4. Do not contact the compound with strong oxidants and other substances.
5. If ingestion or accidental entry into the mouth, immediately seek medical attention or professional advice for help.
Last Update:2024-04-09 21:22:08