127510-95-6

127510-95-6 - Names and Identifiers

Name	METHYL 2-CYANO-5-METHOXYBENZOATE
Synonyms	METHYL 2-CYANO-5-METHOXYBENZOATE 2-CYANO-5-METHOXYBENZOIC ACID METHYL ESTER Benzoic acid, 2-cyano-5-methoxy-, methyl ester Benzoic acid, 2-cyano-5-Methoxy-, Methyl ester
CAS	127510-95-6
InChI	InChI=1/C10H9NO3/c1-13-8-4-3-7(6-11)9(5-8)10(12)14-2/h3-5H,1-2H3

127510-95-6 - Physico-chemical Properties

Molecular Formula	C10H9NO3
Molar Mass	191.18
Density	1.2g/cm³
Boling Point	340.2°C at 760 mmHg
Flash Point	148.4°C
Vapor Presure	8.73E-05mmHg at 25°C
Storage Condition	Sealed in dry,Room Temperature
Refractive Index	1.527

127510-95-6 - Introduction

Methyl 2-cyano-5-methoxybenzoate is a chemical compound whose chemical formula is C10H9NO2. The following is a description of the properties, uses, preparation and safety information of the compound:

Nature:
-Appearance: 2-Cyano-5-methoxybenzoic acid methyl ester is a colorless to light yellow liquid.
-Solubility: It can be dissolved in some organic solvents, such as alcohol, ketone and ether solvents.
-Melting point and boiling point: Its melting point is -17°C, and the boiling point is 230-232°C.
-Stability: 2-cyano-5-methoxybenzoic acid methyl ester is relatively stable at room temperature.

Use:
-Chemical intermediate: It is used as an intermediate for the synthesis of other organic compounds.
-Pesticide: 2-cyano-5-methoxybenzoic acid methyl ester can be used to synthesize some pesticides, such as pesticides and herbicides.

Preparation Method:
2-Cyano-5-methoxybenzoic acid methyl ester can be prepared by the following steps:
1. The p-methoxybenzaldehyde and sodium cyanide are reacted under alkaline conditions to obtain methyl p-iron nitride -4-methoxybenzoate.
2. remove HCl from methyl p-iron nitride -4-methoxybenzoate and triethylamine or other bases during the reaction to obtain methyl 2-cyano -5-methoxybenzoate.

Safety Information:
-2-cyano-5-methoxybenzoic acid methyl ester is generally safe under normal conditions of use.
-However, it is a chemical substance that requires attention to irritation to the skin, eyes and respiratory system.
-Appropriate personal protective measures, such as gloves, face shield and goggles, are required during use and storage.
-If contact or inhalation occurs, rinse immediately with plenty of water and seek medical advice.

Last Update：2024-04-10 22:29:15