127852-31-7

127852-31-7 - Names and Identifiers

Name	(R)-3-(1-aminoethyl)benzonitrile
Synonyms	(R)-3-1-Aminoethy (1R)-1-(3-Cyanophene 3-[(1R)-1-aMinoethyl]- (R)-1-(3-Cyanophenyl)ethylamine (R)-3-(1-Aminoethyl)benzonitrile (R)-3-(1-aminoethyl)benzonitrile (R)-3-(1-AMINOETHYL)BENZONITRILE-HCl Benzonitrile, 3-[(1R)-1-aminoethyl]- (R)-3-(1-Aminoethyl)benzonitrilehydrochloride
CAS	127852-31-7
InChI	InChI=1/C9H10N2/c1-7(11)9-4-2-3-8(5-9)6-10/h2-5,7H,11H2,1H3/t7-/m1/s1

127852-31-7 - Physico-chemical Properties

Molecular Formula	C9H10N2
Molar Mass	146.19
Density	1.06±0.1 g/cm3(Predicted)
Boling Point	251.4±23.0 °C(Predicted)
pKa	8.59±0.10(Predicted)
Storage Condition	under inert gas (nitrogen or Argon) at 2–8 °C
Refractive Index	1.557

127852-31-7 - Introduction

(R)-3-(1-aminoethyl) benzonitrile, chemical formula C10H12N2, is an organic compound. It is a white powder in a solid crystalline state with a special ammonia smell.

(R)-3-(1-aminoethyl) benzonitrile has some of the following properties:
1. the melting point is 148-152 ℃ and the boiling point is 327 ℃.
2. Soluble in common organic solvents, such as ethanol, chloroform, ether, etc.
3. It has chirality and has two enantiomers.

(R)-3-(1-aminoethyl) benzonitrile is mainly used in the field of pharmaceutical synthesis and organic synthesis. Its main uses include:
1. as a drug intermediate, used in the synthesis of amino acids, peptides and other drug molecular structure construction.
2. used as chiral catalyst for synthesis of chiral compounds.
3. for important catalytic reactions in organic synthesis, such as nucleophilic substitution reactions, amidation reactions, etc.

The method for preparing (R)-3-(1-aminoethyl) benzonitrile is complex, and the common synthetic route includes using 1-bromo-3-chloropropane and benzaldehyde as raw materials to react under alkaline conditions to generate the target product.

Regarding safety information, if there is contact or inhalation, avoid skin contact and inhalation to avoid discomfort or harmful reactions. When using or handling the compound, take care to wear appropriate protective equipment, such as gloves, safety glasses, etc. At the same time, avoid contact with strong oxidants and heat sources to avoid dangerous or unstable reactions. In any experimental or production environment in which the compound is used, relevant safety practices and operating procedures must be followed. If inhaled or ingested, seek medical help immediately.

Last Update：2024-04-09 21:11:58