1287-16-7
Ferrocenylacetic acid
CAS: 1287-16-7
Molecular Formula: C12H12FeO210*
1287-16-7 - Names and Identifiers
| Name | Ferrocenylacetic acid |
| Synonyms | NSC 128978 ferroceneacetic Ferrocenfethanol Ferroceneacetic acid Ferrocenylacetic acid Ferrocenyl Acetic Acid Carboxymethylferrocene |
| CAS | 1287-16-7 |
| InChI | InChI=1/C7H7O2.C5H5.Fe/c8-7(9)5-6-3-1-2-4-6;1-2-4-5-3-1;/h1-4H,5H2,(H,8,9);1-5H |
1287-16-7 - Physico-chemical Properties
| Molecular Formula | C12H12FeO210* |
| Molar Mass | 244.07 |
| Melting Point | 158-160°C(lit.) |
| Solubility | DMSO (Slightly), Methanol (Slightly) |
| Appearance | Gold powder |
| Color | Gold to orange-brown |
| Storage Condition | Inert atmosphere,Room Temperature |
| Stability | Stable. Incompatible with strong oxidizing agents. |
| MDL | MFCD00045464 |
1287-16-7 - Risk and Safety
| Hazard Symbols | Xn - Harmful |
| Risk Codes | R36/37/38 - Irritating to eyes, respiratory system and skin. R22 - Harmful if swallowed |
| Safety Description | S37/39 - Wear suitable gloves and eye/face protection S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| WGK Germany | 3 |
| HS Code | 29319090 |
1287-16-7 - Introduction
Ferrocenacetic acid is an organic compound with the chemical formula Fe(C5H5)2(C2H3O2). The following is an introduction to the properties, uses, methods and safety information of ferrocene acetic acid:
Nature:
1. Appearance: Ferrocenyl acetic acid is red-brown crystal or powder solid.
2. Melting point: about 162-163°C.
3. Solubility: Ferrocenyl acetic acid soluble in organic solvents such as ethanol, acetone and dichloromethane, slightly soluble in water.
Use:
1. Catalyst: Ferrocenyl acetic acid can be used as a catalyst for various reactions, such as oxidation reaction, carbonylation reaction and asymmetric catalytic reaction.
2. Electrochemical applications: Ferrocenyl acetic acid can be used in battery systems as a positive active material.
3. Optical applications: Because ferrocenyl acetic acid has a variable electronic state, it can also be used for control devices in liquid crystal displays.
Preparation Method:
The preparation method of ferrocenyl acetic acid usually has the following ways:
1. Synthesis by a reaction between a metallocene compound and acetic acid.
2. by ferrocene and chloroacetic acid reaction, and then through dehydration and crystallization purification.
Safety Information:
1. Ferrocenyl acetic acid may be irritating to the eyes, skin and respiratory system, so wear appropriate personal protective equipment during operation.
2. avoid inhalation of dust or skin contact, avoid eating.
3. in the use of the process to maintain good ventilation conditions.
4. avoid contact with strong oxidants, strong acids and other substances to prevent dangerous reactions.
5. Comply with relevant regulations and standards for chemicals during storage and handling.
Nature:
1. Appearance: Ferrocenyl acetic acid is red-brown crystal or powder solid.
2. Melting point: about 162-163°C.
3. Solubility: Ferrocenyl acetic acid soluble in organic solvents such as ethanol, acetone and dichloromethane, slightly soluble in water.
Use:
1. Catalyst: Ferrocenyl acetic acid can be used as a catalyst for various reactions, such as oxidation reaction, carbonylation reaction and asymmetric catalytic reaction.
2. Electrochemical applications: Ferrocenyl acetic acid can be used in battery systems as a positive active material.
3. Optical applications: Because ferrocenyl acetic acid has a variable electronic state, it can also be used for control devices in liquid crystal displays.
Preparation Method:
The preparation method of ferrocenyl acetic acid usually has the following ways:
1. Synthesis by a reaction between a metallocene compound and acetic acid.
2. by ferrocene and chloroacetic acid reaction, and then through dehydration and crystallization purification.
Safety Information:
1. Ferrocenyl acetic acid may be irritating to the eyes, skin and respiratory system, so wear appropriate personal protective equipment during operation.
2. avoid inhalation of dust or skin contact, avoid eating.
3. in the use of the process to maintain good ventilation conditions.
4. avoid contact with strong oxidants, strong acids and other substances to prevent dangerous reactions.
5. Comply with relevant regulations and standards for chemicals during storage and handling.
Last Update：2024-04-10 22:29:15
Supplier List
Spot supply
Product Name: Ferroceneacetic Acid Visit Supplier Webpage Request for quotationCAS: 1287-16-7
Tel: +86-400-900-4166
Email: product@acmec-e.com
Mobile: +86-18621343501
QQ: 2881950922
Wechat: 18621343501
WhatsApp: +86-18621343501
Spot supply
Product Name: Ferroceneacetic acid Visit Supplier Webpage Request for quotationCAS: 1287-16-7
Tel: +86-18821248368
Email: Int06@meryer.com
Mobile: +86-18821248368
QQ: 495145328
WhatsApp: +86-18821248368
Spot supply
Product Name: Ferroceneacetic Acid Visit Supplier Webpage Request for quotationCAS: 1287-16-7
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Spot supply
Product Name: Ferroceneacetic Acid Visit Supplier Webpage Request for quotationCAS: 1287-16-7
Tel: +86-400-900-4166
Email: product@acmec-e.com
Mobile: +86-18621343501
QQ: 2881950922
Wechat: 18621343501
WhatsApp: +86-18621343501
Spot supply
Product Name: Ferroceneacetic acid Visit Supplier Webpage Request for quotationCAS: 1287-16-7
Tel: +86-18821248368
Email: Int06@meryer.com
Mobile: +86-18821248368
QQ: 495145328
WhatsApp: +86-18821248368
Spot supply
Product Name: Ferroceneacetic Acid Visit Supplier Webpage Request for quotationCAS: 1287-16-7
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
View History