Name | 3-(Aminomethyl)-5-methylhexanoic acid |
Synonyms | rac-CI-1008 rac-PD-144723 RAC Pregabalin RAC PREGABALIN rac-Pregabalin-d10 Pregabalin Racemate N,5-dimethylhexan-3-amine 3-(Aminomethyl)-5-methylhexanoic acid (±)-3-Aminomethyl-5-methylhexanoic acid Hexanoic acid, 3-(aminomethyl)-5-methyl- (RS)-3-AMINOMETHYL-5-METHYLHEXANOIC ACID (RS)-3-Aminomethyl-5-methylhexanoic acid (+)-3-(Aminomethyl)-5-methylhexanoic acid Racemic Pregabalin (3-(Aminomethyl)-5-Methylhexanoic Acid) |
CAS | 128013-69-4 130912-52-6 |
EINECS | 2017-001-1 |
InChI | InChI=1/C8H17NO2.H2O/c1-6(2)3-7(5-9)4-8(10)11;/h6-7H,3-5,9H2,1-2H3,(H,10,11);1H2 |
Molecular Formula | C8H17NO2 |
Molar Mass | 159.23 |
Density | 0.997 |
Melting Point | 148-150oC |
Boling Point | 274°C |
Flash Point | 119°C |
Appearance | White powder |
pKa | 4.23±0.10(Predicted) |
Storage Condition | -20°C Freezer |
use | 3-(aminomethyl)-5-methylhexanoic acid is an intermediate in organic synthesis and a pharmaceutical intermediate, mainly used as an intermediate of raw material drug pregabalin in laboratory research and development and chemical pharmaceutical synthesis. |