133040-03-6

133040-03-6 - Names and Identifiers

Name	Methyl 4-[(2-butyl-5-formyl-1H-imidazol-1-yl) methyl] benzoate
Synonyms	METHYL 4-[(2-BUTYL-5-FORMYL-1H-IMIDAZOL-1-YL)METHYL]BENZOATE Methyl,4-[(2-butyl-5-formyl-1H-imidazol-1-yl)methyl]benzoate Methyl 4-[(2-butyl-5-formyl-1H-imidazol-1-yl) methyl] benzoate Methyl 4-[(2-butyl-5-formyl-1H-imidazol-1-yl) methyl] benzoa... 4-[(2-Butyl-5-forMyliMidazol-1-yl)Methyl]benzoic Acid Methyl Ester 2-N-Butyl-1-[(4-Carbomethoxyphenyl)Methyl]-1H-Inidazol-5-Carboxaldehyde 2-n-butyl-1-[(4-carbomethoxyphenyl)methyl]-1H-imidazol-5-carboxaldehyde Benzoic acid, 4-[(2-butyl-5-formyl-1H-imidazol-1-yl)methyl]-, methyl ester
CAS	133040-03-6
InChI	InChI=1S/C17H20N2O3/c1-3-4-5-16-18-10-15(12-20)19(16)11-13-6-8-14(9-7-13)17(21)22-2/h6-10,12H,3-5,11H2,1-2H3

133040-03-6 - Physico-chemical Properties

Molecular Formula	C17H20N2O3
Molar Mass	300.35
Density	1.13±0.1 g/cm3(Predicted)
Melting Point	72-74 °C
Boling Point	473.8±30.0 °C(Predicted)
Flash Point	240.4 °C
Solubility	Dichloromethane, Methanol
Appearance	Oil
pKa	4.26±0.34(Predicted)

133040-03-6 - Introduction

Methyl 4-[(2-tert-butyl-5-carbaldehyde-1H-imidazol-1-yl) methyl] benzoate (abbreviation: BTMA) is an organic compound with the following properties and uses:

Nature:
1. Appearance: BTMA is a colorless to yellowish liquid.
2. molecular formula: C15H21NO2
3. molecular weight: 247.33
4. Melting point:-60°C
5. Boiling point: 110-111°C
6. Solubility: BTMA is soluble in organic solvents such as ethanol, ether and dichloromethane.

Use:
The main uses of BTMA are as follows:
1. Catalyst: BTMA can be used as a catalyst for copper-catalyzed oxidation reactions.
2. electrolyte additives: BTMA can be used in the electrolyte of lithium ion batteries and supercapacitors to improve battery performance.
3. pharmaceutical field: BTMA can be used to synthesize some pharmaceutical intermediates.
4. cosmetics field: BTMA can be used in some cosmetics, with antiseptic effect.

Preparation Method:
The synthesis of BTMA can be carried out by the following steps:
1. Condensation of tert-butyl alcohol with formaldehyde to give 2-tert-butyl-5-carboxaldehyde -1H-imidazole.
2. Reaction of 1H-imidazole with methyl benzoate to obtain methyl 4-[(2-tert-butyl-5-carbaldehyde -1H-imidazol -1-yl) methyl] benzoate.

Safety Information:
1. BTMA is irritating and should avoid contact with skin, eyes and respiratory tract.
2. Wear protective gloves, goggles and respiratory protection when using BTMA.
3. In case of contact with BTMA, rinse with plenty of water and consult a doctor.
4. BTMA should be stored in a cool, ventilated place, away from fire and oxidant.
5. When using BTMA for experiments, please pay attention to comply with the safe operation specifications of the chemical laboratory.

Last Update：2024-04-09 15:17:51