13472-81-6
3,5-Dibromo-2-hydroxypyridine
CAS: 13472-81-6
Molecular Formula: C5H3Br2NO
13472-81-6 - Names and Identifiers
| Name | 3,5-Dibromo-2-hydroxypyridine |
| Synonyms | AURORA KA-374 AKOS BBS-00001372 3,5-DIBROMO-2-PYRIDONE 3,5-Dibromo-2-pyridinol 3,5-DIBROMOPYRIDIN-2-OL 3,5-DIBROMO-2-PYRIDINOL 3,5-DIBROMO-2(1H)-PYRIDINONE 3,5-dibromopyridin-2(1H)-one 3,5-Dibromo-2-hydroxypyridine 2-HYDROXY-3,5-DIBROMOPYRIDINE 3,5-DIBROMO-2-HYDROXYPYRIDINE |
| CAS | 13472-81-6 |
| EINECS | 634-378-9 |
| InChI | InChI=1/C5H3Br2NO/c6-3-1-4(7)5(9)8-2-3/h1-2H,(H,8,9) |
13472-81-6 - Physico-chemical Properties
| Molecular Formula | C5H3Br2NO |
| Molar Mass | 252.89 |
| Density | 2.293±0.06 g/cm3(Predicted) |
| Melting Point | 204-210 °C |
| Boling Point | 290.4±40.0 °C(Predicted) |
| Flash Point | 129.4°C |
| Vapor Presure | 0.00208mmHg at 25°C |
| Appearance | Solid |
| Color | Beige to light brown |
| BRN | 119389 |
| pKa | 8.48±0.10(Predicted) |
| Storage Condition | Inert atmosphere,Room Temperature |
| Refractive Index | 1.672 |
| MDL | MFCD00023472 |
13472-81-6 - Risk and Safety
| Hazard Symbols | Xn - Harmful |
| Risk Codes | R36/37/38 - Irritating to eyes, respiratory system and skin. R22 - Harmful if swallowed R20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. |
| Safety Description | S37/39 - Wear suitable gloves and eye/face protection S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. S45 - In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.) |
| UN IDs | 2811 |
| HS Code | 29333999 |
13472-81-6 - Introduction
3,5-dibromo-2-hydroxypyrimidine is an organic compound with the molecular formula C5H3Br2N2O and the structural formula Br-C6H3-B(OH)-N(Br). The following is a detailed description of its properties, uses, preparation methods and safety information:
Nature:
1. Appearance: 3,5-dibromo -2-hydroxyl pyrimidine is a colorless to light yellow solid.
2. Solubility: It is soluble in common organic solvents, such as ethanol and dimethyl sulfoxide.
3. Melting point: Its melting point is about 256-258 degrees Celsius.
Use:
As an important organic intermediate, 3,5-dibromo-2-hydroxypyrimidine is widely used in the synthesis of drugs and pesticides. It is often used in the synthesis of pyrimidine anticancer drugs, antiviral drugs and heterocyclic compounds.
Preparation Method:
The method for preparing 3,5-dibromo-2-hydroxypyrimidine mainly includes the following steps:
1. First, 2,4-dinitrochlorobenzene is reacted with boron tribromide to obtain 2,4-dibromo -5-nitrochlorobenzene.
2. Then, 2,4-dibromo -5-nitrochlorobenzene and bromine are reacted under alkaline conditions to generate 3,5-dibromo -2-nitrobenzene.
3. Next, 3,5-dibromo -2-nitrobenzene is reacted with sodium hydroxide (NaOH) solution to generate 3,5-dibromo-2-hydroxybenzene.
4. Finally, 3,5-dibromo-2-hydroxybenzene is reacted with ammonia gas to obtain the final product 3,5-dibromo-2-hydroxypyrimidine.
Safety Information:
1. 3,5-dibromo-2-hydroxypyrimidine should be stored in a dry, well-ventilated place away from direct sunlight.
2. during use, should wear appropriate protective equipment, such as gloves, goggles and protective clothing.
3. avoid contact with skin, eyes, mucous membrane. If exposed to the compound, rinse immediately with plenty of water and seek medical help.
4. 3,5-Dibromo-2-hydroxypyrimidine is a hazardous substance and should be disposed of properly and in accordance with relevant regulations.
Nature:
1. Appearance: 3,5-dibromo -2-hydroxyl pyrimidine is a colorless to light yellow solid.
2. Solubility: It is soluble in common organic solvents, such as ethanol and dimethyl sulfoxide.
3. Melting point: Its melting point is about 256-258 degrees Celsius.
Use:
As an important organic intermediate, 3,5-dibromo-2-hydroxypyrimidine is widely used in the synthesis of drugs and pesticides. It is often used in the synthesis of pyrimidine anticancer drugs, antiviral drugs and heterocyclic compounds.
Preparation Method:
The method for preparing 3,5-dibromo-2-hydroxypyrimidine mainly includes the following steps:
1. First, 2,4-dinitrochlorobenzene is reacted with boron tribromide to obtain 2,4-dibromo -5-nitrochlorobenzene.
2. Then, 2,4-dibromo -5-nitrochlorobenzene and bromine are reacted under alkaline conditions to generate 3,5-dibromo -2-nitrobenzene.
3. Next, 3,5-dibromo -2-nitrobenzene is reacted with sodium hydroxide (NaOH) solution to generate 3,5-dibromo-2-hydroxybenzene.
4. Finally, 3,5-dibromo-2-hydroxybenzene is reacted with ammonia gas to obtain the final product 3,5-dibromo-2-hydroxypyrimidine.
Safety Information:
1. 3,5-dibromo-2-hydroxypyrimidine should be stored in a dry, well-ventilated place away from direct sunlight.
2. during use, should wear appropriate protective equipment, such as gloves, goggles and protective clothing.
3. avoid contact with skin, eyes, mucous membrane. If exposed to the compound, rinse immediately with plenty of water and seek medical help.
4. 3,5-Dibromo-2-hydroxypyrimidine is a hazardous substance and should be disposed of properly and in accordance with relevant regulations.
Last Update：2024-04-09 21:01:54
Supplier List
Spot supply
Product Name: 3,5-Dibromo-2-Pyridinol Visit Supplier Webpage Request for quotationCAS: 13472-81-6
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Spot supply
Product Name: 3,5-Dibromo-2-Pyridinol Visit Supplier Webpage Request for quotationCAS: 13472-81-6
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History