135050-44-1
3-Chloro-4-iodoaniline
CAS: 135050-44-1
Molecular Formula: C6H5ClIN
135050-44-1 - Names and Identifiers
| Name | 3-Chloro-4-iodoaniline |
| Synonyms | 3-Chloro-4-iodoaniline 3-CHLORO-4-IODOANILINE 3-Chloro-4-iodo-phenylamine 4-Amino-2-chloroiodobenzene benzenamine, 3-chloro-4-iodo- Benzenamine, 3-chloro-4-iodo- |
| CAS | 135050-44-1 |
| InChI | InChI=1/C6H5ClIN/c7-5-3-4(9)1-2-6(5)8/h1-3H,9H2 |
| InChIKey | ONZHMGRKWJMTDE-UHFFFAOYSA-N |
135050-44-1 - Physico-chemical Properties
| Molecular Formula | C6H5ClIN |
| Molar Mass | 253.47 |
| Density | 1.9011 (estimate) |
| Melting Point | 65-70 °C |
| Boling Point | 312.8±27.0 °C(Predicted) |
| Flash Point | 143℃ |
| Vapor Presure | 0.000518mmHg at 25°C |
| Appearance | White to beige powder or crystal |
| BRN | 3236464 |
| pKa | 2.75±0.10(Predicted) |
| Storage Condition | 2-8°C |
| Sensitive | Light Sensitive |
| Refractive Index | 1.694 |
| MDL | MFCD00051845 |
| Physical and Chemical Properties | Sensitivity: Light Sensitive |
135050-44-1 - Risk and Safety
| Risk Codes | R36/37/38 - Irritating to eyes, respiratory system and skin. R20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. |
| Safety Description | S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| UN IDs | UN2811 |
| WGK Germany | 3 |
| HS Code | 29214200 |
| Hazard Note | Irritant |
| Hazard Class | 6.1 |
| Packing Group | III |
135050-44-1 - Introduction
3-Chloro-4-iodoaniline is an organic compound with the chemical formula C6H4ClIN. Its properties are as follows:
1. Appearance and physical properties: 3-chloro-4-iodoaniline is a white crystalline solid with a special smell.
2. Solubility: 3-chloro-4-iodoaniline is soluble in organic solvents such as alcohols, ethers and ketones, and insoluble in water.
3. chemical properties: 3-chlorine -4-iodine aniline is a kind of active compounds, it can participate in the amination reaction, aromatic electrophilic substitution reaction.
According to its properties, 3-chloro-4-iodoaniline has the following uses in practical applications:
1. Chemical synthesis: As intermediates and raw materials in organic synthesis, it can be used to synthesize other organic compounds, such as drugs, dyes and pesticides.
2. Scientific research: catalysts or catalytic reagents that can be used for organic synthesis reactions, as well as for studying the reaction mechanism of organic compounds.
3. Dyes and pigments: Because of their variable molecular structure, they can be used as basic materials for dyes and pigments.
The methods for preparing 3-chloro-4-iodoaniline are mainly as follows:
1. Taking 2-chloro-4-iodoaniline as the starting material, 3-chloro-4-iodoaniline was obtained by conversion of the reaction intermediate.
2. 3-chloro-4-iodoaniline is obtained by iodinating 3-chlorobenzene.
Regarding safety information, 3-chloro-4-iodoaniline is a compound with certain toxicity. When using the need to pay attention to the following situations:
1. cause eye and skin irritation: contact with 3-chlorine -4-iodine aniline can cause eye and skin irritation. Wear appropriate protective gloves, goggles and laboratory coats when using.
2. respiratory irritation: inhalation of 3-chlorine -4-iodine aniline gas or vapor can cause respiratory irritation. Operate in a well-ventilated area or wear an appropriate protective mask.
3. avoid mixing with other chemicals: 3-chlorine -4-iodine aniline may react with other chemicals, causing danger. Avoid contact with incompatible substances.
4. Storage and handling: 3-chloro-4-iodoaniline should be stored in a dry, ventilated place, and avoid contact with oxidants and high temperature conditions.
Please note that safe practices should be followed when using and handling 3-chloro-4-iodoaniline, and refer to relevant information and safety data sheets as appropriate.
1. Appearance and physical properties: 3-chloro-4-iodoaniline is a white crystalline solid with a special smell.
2. Solubility: 3-chloro-4-iodoaniline is soluble in organic solvents such as alcohols, ethers and ketones, and insoluble in water.
3. chemical properties: 3-chlorine -4-iodine aniline is a kind of active compounds, it can participate in the amination reaction, aromatic electrophilic substitution reaction.
According to its properties, 3-chloro-4-iodoaniline has the following uses in practical applications:
1. Chemical synthesis: As intermediates and raw materials in organic synthesis, it can be used to synthesize other organic compounds, such as drugs, dyes and pesticides.
2. Scientific research: catalysts or catalytic reagents that can be used for organic synthesis reactions, as well as for studying the reaction mechanism of organic compounds.
3. Dyes and pigments: Because of their variable molecular structure, they can be used as basic materials for dyes and pigments.
The methods for preparing 3-chloro-4-iodoaniline are mainly as follows:
1. Taking 2-chloro-4-iodoaniline as the starting material, 3-chloro-4-iodoaniline was obtained by conversion of the reaction intermediate.
2. 3-chloro-4-iodoaniline is obtained by iodinating 3-chlorobenzene.
Regarding safety information, 3-chloro-4-iodoaniline is a compound with certain toxicity. When using the need to pay attention to the following situations:
1. cause eye and skin irritation: contact with 3-chlorine -4-iodine aniline can cause eye and skin irritation. Wear appropriate protective gloves, goggles and laboratory coats when using.
2. respiratory irritation: inhalation of 3-chlorine -4-iodine aniline gas or vapor can cause respiratory irritation. Operate in a well-ventilated area or wear an appropriate protective mask.
3. avoid mixing with other chemicals: 3-chlorine -4-iodine aniline may react with other chemicals, causing danger. Avoid contact with incompatible substances.
4. Storage and handling: 3-chloro-4-iodoaniline should be stored in a dry, ventilated place, and avoid contact with oxidants and high temperature conditions.
Please note that safe practices should be followed when using and handling 3-chloro-4-iodoaniline, and refer to relevant information and safety data sheets as appropriate.
Last Update：2024-04-09 21:04:16
Supplier List
Product Name: 3-Chloro-4-Iodoaniline Visit Supplier Webpage Request for quotation
CAS: 135050-44-1
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 135050-44-1
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: 3-Chloro-4-Iodoaniline Visit Supplier Webpage Request for quotation
CAS: 135050-44-1
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 135050-44-1
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History