154-07-4
5-Chloro-DL-tryptophan
CAS: 154-07-4
Molecular Formula: C11H11ClN2O2
154-07-4 - Names and Identifiers
| Name | 5-Chloro-DL-tryptophan |
| Synonyms | H-Trp(5-Cl)-OH 5-chloro-tryptophan H-5-CHLORO-DL-TRP-OH Tryptophan, 5-chloro- 5-Cloro-DL-tryptophan DL-5-ChloroTryptophan 5-Chloro-DL-tryptophan 5-CHLORO-DL-TRYPTOPHAN DL-2-AMINO-3(5-CHLOROINDOLYL)PROPIONIC ACID |
| CAS | 154-07-4 |
| InChI | InChI=1/C11H11ClN2O2/c12-7-1-2-10-8(4-7)6(5-14-10)3-9(13)11(15)16/h1-2,4-5,9,14H,3,13H2,(H,15,16)/t9-/m0/s1 |
154-07-4 - Physico-chemical Properties
| Molecular Formula | C11H11ClN2O2 |
| Molar Mass | 238.67 |
| Density | 1.474g/cm3 |
| Boling Point | 476.9°C at 760 mmHg |
| Flash Point | 242.2°C |
| Solubility | Aqueous Acid (Slightly), Methanol (Slightly) |
| Vapor Presure | 6.66E-10mmHg at 25°C |
| Appearance | Solid |
| Color | White to Off-White |
| Storage Condition | under inert gas (nitrogen or Argon) at 2–8 °C |
| Refractive Index | 1.701 |
154-07-4 - Introduction
5-Chloro-DL-tryptophan is an amino acid derivative with the following properties:
1. Appearance: white crystal or crystalline powder.
2. Solubility: Soluble in water, soluble in acid, alkali and organic solvents.
3. Thermal stability: stable at high temperature.
4. Chromatographic properties: can be applied to gas chromatography and liquid chromatography analysis method.
5. Optical rotation: DL-tryptophan is a kind of optical material, can optical rotation plane polarization direction.
The use of 5-Chloro-DL-tryptophan is as follows:
1. Pharmaceutical field: can be used for the synthesis of anti-tumor drugs, antidepressants and bioactive peptides.
2. Cosmetics field: can be used as raw materials for whitening and anti-aging products.
3. Food additives: can be used as food flavor and increase color additives.
The methods for preparing 5-choro-dl-tryptophan mainly include chemical synthesis and fermentation:
1. Chemical synthesis: 5-Chloro-DL-tryptophan can be obtained by chlorinating DL-tryptophan.
2. Fermentation method: 5-choro-dl-tryptophan is synthesized by fermentation reaction using microorganisms or yeast.
For safety information, 5-Chloro-DL-tryptophan should be used as follows:
1. Avoid inhaling dust, avoid contact with eyes and skin. Always wear personal protective equipment such as gloves, safety glasses and dust mask when using.
2. Operate in a well-ventilated place and maintain a clean and tidy working environment.
3. If the external contact with chemicals, rinse the skin with plenty of water immediately, or rinse the eyes with plenty of water. If necessary, seek medical treatment in time.
When using 5-chroo-dl-tryptophan, please follow the relevant safety procedures and follow the safety data sheet provided by the manufacturer or supplier.
1. Appearance: white crystal or crystalline powder.
2. Solubility: Soluble in water, soluble in acid, alkali and organic solvents.
3. Thermal stability: stable at high temperature.
4. Chromatographic properties: can be applied to gas chromatography and liquid chromatography analysis method.
5. Optical rotation: DL-tryptophan is a kind of optical material, can optical rotation plane polarization direction.
The use of 5-Chloro-DL-tryptophan is as follows:
1. Pharmaceutical field: can be used for the synthesis of anti-tumor drugs, antidepressants and bioactive peptides.
2. Cosmetics field: can be used as raw materials for whitening and anti-aging products.
3. Food additives: can be used as food flavor and increase color additives.
The methods for preparing 5-choro-dl-tryptophan mainly include chemical synthesis and fermentation:
1. Chemical synthesis: 5-Chloro-DL-tryptophan can be obtained by chlorinating DL-tryptophan.
2. Fermentation method: 5-choro-dl-tryptophan is synthesized by fermentation reaction using microorganisms or yeast.
For safety information, 5-Chloro-DL-tryptophan should be used as follows:
1. Avoid inhaling dust, avoid contact with eyes and skin. Always wear personal protective equipment such as gloves, safety glasses and dust mask when using.
2. Operate in a well-ventilated place and maintain a clean and tidy working environment.
3. If the external contact with chemicals, rinse the skin with plenty of water immediately, or rinse the eyes with plenty of water. If necessary, seek medical treatment in time.
When using 5-chroo-dl-tryptophan, please follow the relevant safety procedures and follow the safety data sheet provided by the manufacturer or supplier.
Last Update：2024-04-09 20:02:46
Supplier List
Product Name: 5-CHLORO-DL-TRYPTOPHAN Visit Supplier Webpage Request for quotation
CAS: 154-07-4
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 154-07-4
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: 5-CHLORO-DL-TRYPTOPHAN Visit Supplier Webpage Request for quotation
CAS: 154-07-4
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 154-07-4
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History