154151-01-6 - Names and Identifiers
Name | 2,5-diamino-4'-(dimethylamino)-4-nitrostilbene
|
Synonyms | 2,5-diamino-4'-(dime 2,5-diamino-4'-(dimethylamino)-4-nitrostilbene trans-2,5-Diamino-4'-(dimethylamino)-4-nitrostilbene trans-2,5-DiaMino-4'-(diMethylaMino)-4-nitrostilbene 2-[(E)-2-(4-dimethylaminophenyl)vinyl]-5-nitro-benzene-1,4-diamine 2-[(1E)-2-[4-(Dimethylamino)phenyl]ethenyl]-5-nitro-1,4-benzenediamine 1,4-Benzenediamine, 2-[(1E)-2-[4-(dimethylamino)phenyl]ethenyl]-5-nitro-
|
CAS | 154151-01-6
|
InChI | InChI=1/C16H18N4O2/c1-19(2)13-7-4-11(5-8-13)3-6-12-9-15(18)16(20(21)22)10-14(12)17/h3-10H,17-18H2,1-2H3/b6-3+ |
154151-01-6 - Physico-chemical Properties
Molecular Formula | C16H18N4O2
|
Molar Mass | 298.34 |
Density | 1.314 |
Boling Point | 525.8°C at 760 mmHg |
Flash Point | 271.8°C |
Vapor Presure | 3.79E-11mmHg at 25°C |
Refractive Index | 1.755 |
154151-01-6 - Introduction
2,5-diamino-4 '-(dimethylamino)-4-nitrostilbene is an organic compound with the following properties:
1. Appearance: It is a pale yellow crystalline solid.
2. Melting point and boiling point: its melting point is 188-190 ° C and boiling point is 583.5 ° C.
3. Solubility: It is soluble in ethanol, ether and carbon disulfide and other organic solvents, but insoluble in water.
2,5-diamino-4 '-(dimethylamino)-4-nitrostilbene is mainly used:
1. Fluorescent dye: It is a green fluorescent dye that can be used to label and track biological molecules.
2. Photosensitive material: Due to its special structure, it can be used for the preparation of photosensitive materials, such as photosensitive materials, optical fibers, etc.
3. Organic synthesis intermediate: It can also be used as an organic synthesis intermediate for the preparation of other complex organic molecules.
2,5-diamino-4 '-(dimethylamino)-4-nitrostilbene is generally prepared by multi-step synthesis. A common method is obtained by the reaction of diaminobenzene and dinitrostyrene.
Regarding safety information, the use of 2,5-diamino-4 '-(dimethylamino)-4-nitrostilbene is subject to relevant safety procedures. It is an organic compound, which belongs to chemicals and has certain toxicity. During use and storage, take appropriate precautions to avoid contact with skin, eyes and inhalation of dust or vapours. If accidentally contact, should immediately rinse with water, and timely medical treatment.
Last Update:2024-04-09 21:04:16