15722-48-2
Olsalazine
CAS: 15722-48-2
Molecular Formula: C14H10N2O6
15722-48-2 - Names and Identifiers
| Name | Olsalazine |
| Synonyms | Ph-CJ-91B Olsalazine OLSALAZINE C.I. Mordant Yellow 5 5,5'-Azodisalicylic acid 5,5'-azobis(salicylicacid) 3,3'-azobis(6-hydroxy-benzoicaci 3,3'-azobis(6-hydroxybenzoicacid) 4,4'-Dihydroxyazobenzene-3,3'-dicarboxylic acid 3,3'-(1,2-diazenediyl)bis[6-hydroxy-Benzoic acid 3,3'-(E)-diazene-1,2-diylbis(6-hydroxybenzoic acid) 5-[(2Z)-2-(3-carboxy-4-oxocyclohexa-2,5-dien-1-ylidene)hydrazino]-2-hydroxybenzoic acid |
| CAS | 15722-48-2 |
| EINECS | 605-089-5 |
| InChI | InChI=1/C14H10N2O6/c17-11-3-1-7(5-9(11)13(19)20)15-16-8-2-4-12(18)10(6-8)14(21)22/h1-6,17-18H,(H,19,20)(H,21,22)/b16-15+ |
15722-48-2 - Physico-chemical Properties
| Molecular Formula | C14H10N2O6 |
| Molar Mass | 302.24 |
| Density | 1.3578 (rough estimate) |
| Melting Point | >300 °C(Solv: acetic acid (64-19-7); water (7732-18-5)) |
| Boling Point | 443.29°C (rough estimate) |
| Flash Point | 348.863°C |
| Water Solubility | 11.49ug/L(25 ºC) |
| Vapor Presure | 0mmHg at 25°C |
| pKa | 2.40±0.10(Predicted) |
| Refractive Index | 1.6500 (estimate) |
| Physical and Chemical Properties | Olsalazine Disodium: C14H8N2Na2O6. Yellow powder. Soluble in water, slightly soluble in ethanol. Melting point> 300 °c. |
| Use | For the treatment of acute and chronic ulcerative colitis and other diseases |
