16726-67-3
5-bromonaphthalene-1-carboxylic acid
CAS: 16726-67-3
Molecular Formula: C11H7BrO2
16726-67-3 - Names and Identifiers
| Name | 5-bromonaphthalene-1-carboxylic acid |
| Synonyms | 5-Bromo-1-naphthoic acid 5-Bromo-phthalene-1-carboxylic acid 5-bromonaphthalene-1-carboxylic acid 5-bromo-1-naphthalenecarboxylic acid 1-Naphthalenecarboxylic acid, 5-bromo- |
| CAS | 16726-67-3 |
| InChI | InChI=1/C11H7BrO2/c12-10-6-2-3-7-8(10)4-1-5-9(7)11(13)14/h1-6H,(H,13,14) |
16726-67-3 - Physico-chemical Properties
| Molecular Formula | C11H7BrO2 |
| Molar Mass | 251.08 |
| Density | 1.5480 (rough estimate) |
| Melting Point | 261°C |
| Boling Point | 421.2±18.0 °C(Predicted) |
| Flash Point | 208.5°C |
| Vapor Presure | 7.58E-08mmHg at 25°C |
| pKa | 3.09±0.10(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.5845 (estimate) |
16726-67-3 - Introduction
acid is an organic compound with the chemical formula C11H8BrCOOH. The following is a description of the properties, uses, preparation and safety information of this compound:
Nature:
1. Appearance: acid is a white crystalline solid.
2. Melting Point: about 117-119 ℃.
3. Solubility: Soluble in organic solvents such as ethanol, ether and chloroform, insoluble in water.
Use:
1. Drug synthesis: acid can be used as a drug intermediate for the synthesis of certain drugs.
2. Pesticide Synthesis: It can also be used as an important raw material for the synthesis of some pesticides.
Method:
The preparation method of acid usually involves the following steps:
1. First, naphthalene and bromine are reacted under the catalysis of ferric chloride to obtain 5-bromonaphthalene.
2. Next, 5-bromonaphthalene is reacted with copper cyanide in the presence of sodium carbonate to produce 5-bromonaphthalenecarbonitrile.
3. Finally, 5-brominated naphthonitrile is hydrolyzed to generate acid.
Safety Information:
1. acid is an organic compound, and care should be taken to prevent contact with eyes, skin and respiratory tract during operation. Wear suitable protective equipment when using.
2. It may be harmful to the environment and should be handled and stored under suitable equipment and places.
3. When using and handling the compound, the relevant safety procedures should be observed, and the safety data sheet and operating instructions of the chemical should be followed.
Nature:
1. Appearance: acid is a white crystalline solid.
2. Melting Point: about 117-119 ℃.
3. Solubility: Soluble in organic solvents such as ethanol, ether and chloroform, insoluble in water.
Use:
1. Drug synthesis: acid can be used as a drug intermediate for the synthesis of certain drugs.
2. Pesticide Synthesis: It can also be used as an important raw material for the synthesis of some pesticides.
Method:
The preparation method of acid usually involves the following steps:
1. First, naphthalene and bromine are reacted under the catalysis of ferric chloride to obtain 5-bromonaphthalene.
2. Next, 5-bromonaphthalene is reacted with copper cyanide in the presence of sodium carbonate to produce 5-bromonaphthalenecarbonitrile.
3. Finally, 5-brominated naphthonitrile is hydrolyzed to generate acid.
Safety Information:
1. acid is an organic compound, and care should be taken to prevent contact with eyes, skin and respiratory tract during operation. Wear suitable protective equipment when using.
2. It may be harmful to the environment and should be handled and stored under suitable equipment and places.
3. When using and handling the compound, the relevant safety procedures should be observed, and the safety data sheet and operating instructions of the chemical should be followed.
Last Update：2024-04-09 21:01:54
Supplier List
Spot supply
Product Name: Naphthoic Acid Impurity 87 Visit Supplier Webpage Request for quotationCAS: 16726-67-3
Tel: 0714-3999186
Email: 2853786052@qq.com
Mobile: 86+15671228036
QQ: 2853786052
Wechat: 15671228036
Spot supply
Product Name: 5-Bromonaphthalene-1-Carboxylic Acid Visit Supplier Webpage Request for quotationCAS: 16726-67-3
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Spot supply
Product Name: Naphthoic Acid Impurity 87 Visit Supplier Webpage Request for quotationCAS: 16726-67-3
Tel: 0714-3999186
Email: 2853786052@qq.com
Mobile: 86+15671228036
QQ: 2853786052
Wechat: 15671228036
Spot supply
Product Name: 5-Bromonaphthalene-1-Carboxylic Acid Visit Supplier Webpage Request for quotationCAS: 16726-67-3
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History