17432-38-1
PENTAMETHYLBENZALDEHYDE
CAS: 17432-38-1
Molecular Formula: C12H16O
17432-38-1 - Names and Identifiers
| Name | PENTAMETHYLBENZALDEHYDE |
| Synonyms | PENTAMETHYLBENZALDEHYDE 2,3,4,5,6-PENTABENZALDEHYDE 2,3,4,5,6-PENTAMETHYL-BENZALDEHYDE |
| CAS | 17432-38-1 |
| InChI | InChI=1/C12H16O/c1-7-8(2)10(4)12(6-13)11(5)9(7)3/h6H,1-5H3 |
17432-38-1 - Physico-chemical Properties
| Molecular Formula | C12H16O |
| Molar Mass | 176.25 |
| Density | 0.9452 (rough estimate) |
| Melting Point | 145-152 °C (lit.)148-153 °C |
| Boling Point | 144 °C/6 mmHg (lit.) |
| Flash Point | 135.9°C |
| Vapor Presure | 0.00159mmHg at 25°C |
| Appearance | Crystalline Powder, Crystals or Flakes |
| Color | Light yellow to beige |
| BRN | 1939311 |
| Storage Condition | Room Temprature |
| Refractive Index | 1.5091 (estimate) |
| MDL | MFCD00015560 |
| Physical and Chemical Properties | WGK Germany:3 |
17432-38-1 - Risk and Safety
| Hazard Symbols | Xn - Harmful |
| Risk Codes | R22 - Harmful if swallowed R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
| FLUKA BRAND F CODES | 10-23 |
| HS Code | 29122900 |
17432-38-1 - Introduction
PENTAMETHYLBENZALDEHYDE is an organic compound with the chemical formula C15H20O. The following is a description of the nature, use, preparation and safety information of PENTAMETHYLBENZALDEHYDE:
Nature:
1. Appearance: PENTAMETHYLBENZALDEHYDE is a colorless to pale yellow liquid.
2. Solubility: It can be dissolved in some organic solvents, such as alcohols and Ether solvents.
3. Melting point and boiling point: PENTAMETHYLBENZALDEHYDE has a melting point of -31 ° C and a boiling point of 276 ° C.
4. Stability: PENTAMETHYLBENZALDEHYDE is relatively stable at room temperature, but it will gradually decompose when exposed to high temperature, sunlight or air.
Use:
1. Spices: PENTAMETHYLBENZALDEHYDE is commonly used as a fragrance ingredient in perfumes and soaps, giving the product a unique smell.
2. Cosmetics: It is also commonly used in cosmetics, such as perfume, shampoo and skin care products, to add fragrance.
3. Chemical Synthesis: PENTAMETHYLBENZALDEHYDE is an important organic synthesis intermediate, which can be used to synthesize other organic compounds, such as plant hormones and drugs.
Method:
The preparation method of PENTAMETHYLBENZALDEHYDE can be obtained by reacting benzaldehyde and methyl alkylating agent. The reaction is generally carried out in a suitable solvent under suitable conditions of temperature and pressure.
Safety Information:
1. PENTAMETHYLBENZALDEHYDE is irritating to eyes and skin, and should be rinsed with plenty of water immediately after contact.
2. When using or storing PENTAMETHYLBENZALDEHYDE, avoid contact with strong oxidants and acidic substances to prevent dangerous reactions.
3. When using, pay attention to well-ventilated places and avoid inhaling its steam.
4. In the operation, should wear appropriate protective gloves and glasses, avoid direct contact.
5. If PENTAMETHYLBENZALDEHYDE is ingested or inhaled, please seek medical attention.
Nature:
1. Appearance: PENTAMETHYLBENZALDEHYDE is a colorless to pale yellow liquid.
2. Solubility: It can be dissolved in some organic solvents, such as alcohols and Ether solvents.
3. Melting point and boiling point: PENTAMETHYLBENZALDEHYDE has a melting point of -31 ° C and a boiling point of 276 ° C.
4. Stability: PENTAMETHYLBENZALDEHYDE is relatively stable at room temperature, but it will gradually decompose when exposed to high temperature, sunlight or air.
Use:
1. Spices: PENTAMETHYLBENZALDEHYDE is commonly used as a fragrance ingredient in perfumes and soaps, giving the product a unique smell.
2. Cosmetics: It is also commonly used in cosmetics, such as perfume, shampoo and skin care products, to add fragrance.
3. Chemical Synthesis: PENTAMETHYLBENZALDEHYDE is an important organic synthesis intermediate, which can be used to synthesize other organic compounds, such as plant hormones and drugs.
Method:
The preparation method of PENTAMETHYLBENZALDEHYDE can be obtained by reacting benzaldehyde and methyl alkylating agent. The reaction is generally carried out in a suitable solvent under suitable conditions of temperature and pressure.
Safety Information:
1. PENTAMETHYLBENZALDEHYDE is irritating to eyes and skin, and should be rinsed with plenty of water immediately after contact.
2. When using or storing PENTAMETHYLBENZALDEHYDE, avoid contact with strong oxidants and acidic substances to prevent dangerous reactions.
3. When using, pay attention to well-ventilated places and avoid inhaling its steam.
4. In the operation, should wear appropriate protective gloves and glasses, avoid direct contact.
5. If PENTAMETHYLBENZALDEHYDE is ingested or inhaled, please seek medical attention.
Last Update：2024-04-09 02:00:43
Supplier List
Product Name: Pentamethylbenzaldehyde Visit Supplier Webpage Request for quotation
CAS: 17432-38-1
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 17432-38-1
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: Pentamethylbenzaldehyde Visit Supplier Webpage Request for quotation
CAS: 17432-38-1
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 17432-38-1
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History