| Name | 2-(3-bromophenyl)-1,3-dioxolane |
| Synonyms | RARECHEM AL BP 0052 2-(3-Bromophenyl)dioxolane 2-(3-bromophenyl)-1,3-dioxane 2-(m-bromophenyl)-1,3-dioxolane 2-(3-bromophenyl)-1,3-dioxolane 1,3-Dioxolane, 2-(m-bromophenyl)- 3-Bromobenzaldehyde ethylene acetal m-Bromobenzaldehyde ethylene acetal 1-BROMO-3-(1,3-DIOXOLAN-2-YL)BENZENE |
| CAS | 17789-14-9 |
| EINECS | 241-766-8 |
| InChI | InChI=1/C10H11BrO2/c11-9-4-1-3-8(7-9)10-12-5-2-6-13-10/h1,3-4,7,10H,2,5-6H2 |
| Molecular Formula | C10H11BrO2 |
| Molar Mass | 243.097 |
| Density | 1.439g/cm3 |
| Boling Point | 306.372°C at 760 mmHg |
| Flash Point | 138.473°C |
| Vapor Presure | 0.001mmHg at 25°C |
| Refractive Index | 1.55 |
| Safety Description | S24/25 - Avoid contact with skin and eyes. |
| Downstream Products | 3-(1,3-Dioxolan-2-yl)aniline 3-(4-Methylpiperazin-1-yl)benzaldehyde |
| storage conditions | Keep in dark place,Inert atmosphere,Room temperature |
| Specific gravity | 1.514 |
| BRN | 1344030 |
| NIST chemical information | 1,3-Dioxolane, 2-(3-bromophenyl)-(17789-14-9) |
| EPA chemical information | 1,3-Dioxolane, 2-(3-bromophenyl)- (17789-14-9) |
| WGK Germany | 3 |