18279-73-7
Diisobutylchlorosilane
CAS: 18279-73-7
Molecular Formula: C8H19ClSi
18279-73-7 - Names and Identifiers
| Name | Diisobutylchlorosilane |
| Synonyms | Diisobutylchlorosilane DIISOBUTYLCHLOROSILANE Chloro(diisobutyl)silane chloro[bis(2-methylpropyl)]silane Silane,chlorobis(2-methylpropyl)- |
| CAS | 18279-73-7 |
| InChI | InChI=1/C8H19ClSi/c1-7(2)5-10(9)6-8(3)4/h7-8,10H,5-6H2,1-4H3 |
18279-73-7 - Physico-chemical Properties
| Molecular Formula | C8H19ClSi |
| Molar Mass | 178.77 |
| Density | 0,995 g/cm3 |
| Boling Point | 160-167°C |
| Flash Point | 42°C |
| Vapor Presure | 1.204mmHg at 25°C |
| Specific Gravity | 0.995 |
| Sensitive | 8: reacts rapidly with moisture, water, protic solvents |
| Refractive Index | 1.4340 |
18279-73-7 - Risk and Safety
| TSCA | No |
18279-73-7 - Introduction
Diisobutylchlorosilane, the chemical formula (CH3) 2CHCH2SIHCL, is also known as Diisobutylchlorosilane. The following is a description of its nature, use, preparation and safety information:
Nature:
1. Appearance: colorless or light yellow liquid.
2. Melting point:-95 ° C.
3. Boiling point: 83-85 ° C.
4. Density: about 0.88g/cm3.
5. Solubility: Soluble in organic solvents such as ether, alcohol, etc.
Use:
1. As the starting reactant of The organosilicon compound.
2. For the synthesis of organic silicon compounds, such as diisobutenyl diisobutyl silane.
3. As a siliconizing agent for the preparation of coatings containing organosilicon compounds.
Method:
diisobutyl chlorosilane can be obtained by reacting hydrochlorosilane with 2-isobutene. The reaction conditions are generally at room temperature and the reaction time is short.
Safety Information:
1. Diisobutylchlorosilane has a pungent smell and should be ventilated when using it.
2. Avoid contact with strong oxidants to avoid fire or explosion.
3. Avoid contact with skin, eyes and respiratory tract. If you accidentally contact, rinse with plenty of water immediately and seek medical help.
4. Storage should be closed, dry, away from the fire and heat source.
5. Use and storage to comply with the relevant safety procedures, wear protective clothing, gloves and goggles and other personal protective measures.
Nature:
1. Appearance: colorless or light yellow liquid.
2. Melting point:-95 ° C.
3. Boiling point: 83-85 ° C.
4. Density: about 0.88g/cm3.
5. Solubility: Soluble in organic solvents such as ether, alcohol, etc.
Use:
1. As the starting reactant of The organosilicon compound.
2. For the synthesis of organic silicon compounds, such as diisobutenyl diisobutyl silane.
3. As a siliconizing agent for the preparation of coatings containing organosilicon compounds.
Method:
diisobutyl chlorosilane can be obtained by reacting hydrochlorosilane with 2-isobutene. The reaction conditions are generally at room temperature and the reaction time is short.
Safety Information:
1. Diisobutylchlorosilane has a pungent smell and should be ventilated when using it.
2. Avoid contact with strong oxidants to avoid fire or explosion.
3. Avoid contact with skin, eyes and respiratory tract. If you accidentally contact, rinse with plenty of water immediately and seek medical help.
4. Storage should be closed, dry, away from the fire and heat source.
5. Use and storage to comply with the relevant safety procedures, wear protective clothing, gloves and goggles and other personal protective measures.
Last Update：2024-04-10 22:29:15
Supplier List
Product Name: DIISOBUTYLCHLOROSILANE Visit Supplier Webpage Request for quotation
CAS: 18279-73-7
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 18279-73-7
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: DIISOBUTYLCHLOROSILANE Visit Supplier Webpage Request for quotation
CAS: 18279-73-7
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 18279-73-7
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History