18637-02-0

18637-02-0 - Names and Identifiers

Name	2-CHLORO-BENZAMIDINE Hydrochloride
Synonyms	2-CHLORO-BENZAMIDINE 2-Chloro-benzamidine, HCl 2-Chlorobenzamidine Hydrochloride 2-CHLORO-BENZAMIDINE Hydrochloride 2-ChlorobenziMidaMide hydrochloride 2-chlorobenzenecarboximidamide hydrochloride 2-CHLOROBENZENECARBOXI MIDAMIDE HYDROCHLORIDE Benzenecarboximidamide,2-chloro-,hydrochloride 2-Chlorobenzene-1-carboximidamide hydrochloride
CAS	18637-02-0
InChI	InChI=1/C7H7ClN2.ClH/c8-6-4-2-1-3-5(6)7(9)10;/h1-4H,(H3,9,10);1H

18637-02-0 - Physico-chemical Properties

Molecular Formula	C7H7ClN2
Molar Mass	154.6
Boling Point	250.3°C at 760 mmHg
Flash Point	105.2°C
Vapor Presure	0.0218mmHg at 25°C
Storage Condition	Inert atmosphere,Room Temperature

18637-02-0 - Introduction

2-chloroo-benzamidine Hydrochloride, chemical formula C7H7ClN · HCl, is an organic compound with the following properties:

1. Appearance: colorless or white crystal powder.
2. Solubility: Soluble in water, soluble in ethanol, chloroform and other organic solvents.
3. Melting Point: about 182-184 ° C.
4. Stability: Stable at room temperature, but will decompose when encountering high temperature or organic solvents.

The main uses of 2-chloroform Hydrochloride are as follows:

1. Insecticide: As an organophosphorus pesticide intermediate, it is widely used in the agricultural field to control various pests.
2. Dye intermediates: can be used as intermediates for the synthesis of certain organic dyes.
3. Pharmaceutical field: may be used for the synthesis of certain drugs.

There are two main methods for the preparation of 2-CHLORO-BENZAMIDINE Hydrochloride:

1. Reaction of methyl chloride with cuprous chloride: reacting methyl chloride with cuprous chloride to generate 2-CHLORO-BENZAMIDINE Hydrochloride.
2. 2-chlorobenzaldehyde reacts with nail brain: 2-chlorobenzaldehyde reacts with nail brain to generate 2-chloro-benzamide Hydrochloride.

When using 2-chroo-benzamidine Hydrochloride, you need to pay attention to its safety information:

1. Toxicity: 2-chroo-benzamidine Hydrochloride has certain toxicity, and direct contact with skin, mouth and eyes should be avoided.
2. Use restrictions: Use in accordance with relevant laws and regulations, and wear appropriate protective equipment.
3. Storage conditions: should be stored in a dry, well-ventilated place, away from fire and flammable materials.
4. Waste disposal: waste should be classified according to local laws and regulations, and should not be poured into water or natural environment at will.

Because 2-choro-benzamidine Hydrochloride has a certain degree of toxicity, it is necessary to be cautious in use and handling, and strictly follow safe operating procedures.

Last Update：2024-04-09 21:21:28