18677-42-4

18677-42-4 - Names and Identifiers

Name	2,6-Dimethoxy-3,5-dinitropyridine
Synonyms	2,6-Dimethoxy-3,5-dinitropyridine 2,6-dimethoxy-3,5-diaminopyridin-2HCl
CAS	18677-42-4
InChI	InChI=1/C7H7N3O6/c1-15-6-4(9(11)12)3-5(10(13)14)7(8-6)16-2/h3H,1-2H3

18677-42-4 - Physico-chemical Properties

Molecular Formula	C7H7N3O6
Molar Mass	229.14698
Density	1.484g/cm³
Boling Point	382.1°C at 760 mmHg
Flash Point	184.9°C
Vapor Presure	1.07E-05mmHg at 25°C
Storage Condition	2-8℃
Refractive Index	1.572

18677-42-4 - Introduction

2,6-dimethoxy-3, 5-dinitropyridine (abbreviated as DNPO) is an organic compound with the chemical formula c₂ H-en-O. The following is a description of its nature, use, preparation and safety information:

Nature:
1. Appearance: DNPO is a colorless crystal.
2. Melting Point: the melting point of DNPO is about 163-164 ℃.
3. Solubility: DNPO has good solubility in some organic solvents (such as ether, xylene, chloroform).

Use:
1. Explosive additives: DNPO is often used as an additive for explosives, which can improve its explosive performance and stability.
2. Chemical synthesis intermediate: DNPO as an organic nitrate, can be used for the synthesis of other organic compounds.
3. Chemical reagent: DNPO has certain application value in organic synthesis and can be used as chemical reagent.

Method:
The preparation of DNPO is usually achieved by nitration reaction. The following is a possible preparation method:
1. First, 2,6-dimethoxypyridine (DMPO) was taken as a starting material.
2. Dissolve DMPO in nitric acid and add catalyst such as sulfuric acid.
3. At an appropriate temperature, control the reaction time, nitration reaction.
4. Washing with water and filtering the product, and then obtaining DNPO by crystallization and other methods.

Safety Information:
1. DNPO belongs to organic nitrates and is explosive. In the operation should pay attention to fire and explosion prevention measures.
2. Avoid inhalation and skin contact. Wear protective gloves, glasses and protective clothing during operation.
3. Storage should be placed in a cool, dry, well-ventilated place, away from fire and combustibles.
4. When disposing of waste, it should be disposed in accordance with the relevant regulations of the local government to avoid environmental pollution.

Last Update：2024-04-10 22:29:15