1H-2-Benzopyran-1-one,3,4-dihydro-(9CI)
3,4-dihydro-1H-2-benzopyran-1-one
CAS: 4702-34-5
Molecular Formula: C9H8O2
1H-2-Benzopyran-1-one,3,4-dihydro-(9CI) - Names and Identifiers
| Name | 3,4-dihydro-1H-2-benzopyran-1-one |
| Synonyms | 1-Isochromanone 1-oxo-isochroMan Einecs 225-179-4 Isochroman-1-one isochroman-1-one Dihydroisocoumarin 3,4-Dihydroisocoumarin 3,4-dihydroisochroMen-1-one 3,4-dihydro-1H-isochromen-1-one 3,4-dihydro-1H-2-benzopyran-1-one 1H-2-Benzopyran-1-one,3,4-dihydro-(9CI) |
| CAS | 4702-34-5 |
| EINECS | 225-179-4 |
| InChI | InChI=1/C9H8O2/c10-9-8-4-2-1-3-7(8)5-6-11-9/h1-4H,5-6H2 |
1H-2-Benzopyran-1-one,3,4-dihydro-(9CI) - Physico-chemical Properties
| Molecular Formula | C9H8O2 |
| Molar Mass | 148.16 |
| Density | 1.2030 |
| Melting Point | 37-39 °C |
| Boling Point | 160°C/11mmHg(lit.) |
| Flash Point | 132.1°C |
| Vapor Presure | 0.00031mmHg at 25°C |
| Appearance | clear liquid |
| Color | Colorless to Light orange to Yellow |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.5640 to 1.5680 |
1H-2-Benzopyran-1-one,3,4-dihydro-(9CI) - Introduction
3, is an organic compound, also known as coumarin. It has the following properties:
1. Appearance: white crystalline powder or colorless crystal.
2. Solubility: Soluble in organic solvents such as alcohol, ether, ester and chloroform, insoluble in water.
3. Chemical properties: 3. It has lively chemical reactivity and can undergo a series of chemical changes through oxidation, acylation, alkylation and other reactions.
3, Lin has a wide range of uses:
1. cosmetics and perfume industry used as a fragrance ingredients, give the product a pleasant aroma.
2. used as an intermediate in the synthesis of drugs, such as anticoagulant drug warfarin synthetic raw materials.
3. used as spice additives in the food industry to increase the aroma of food.
3, the preparation method can be realized by the following methods:
1. coumarin can be synthesized by the reaction of phenolic compounds and cyclic triketone.
2. It can also be prepared by the oxidation reaction of isotryptaminic acid.
Regarding 3, the safety information: Due to the characteristics of chemicals, you need to pay attention to the following matters:
1. 3, it can be decomposed in the air, and oxidation reaction is easy to occur when encountering sunlight and ultraviolet rays.
2. in handling, storage and use, avoid contact with oxidants and strong acids to prevent dangerous reactions.
3. use and storage should wear protective gloves and mask, avoid direct contact with skin and eyes.
4. 3, should be away from fire, stored in a cool, ventilated place.
Please refer to the relevant chemical literature and safety data sheets for further information on the properties, uses, methods and safety of 3.
1. Appearance: white crystalline powder or colorless crystal.
2. Solubility: Soluble in organic solvents such as alcohol, ether, ester and chloroform, insoluble in water.
3. Chemical properties: 3. It has lively chemical reactivity and can undergo a series of chemical changes through oxidation, acylation, alkylation and other reactions.
3, Lin has a wide range of uses:
1. cosmetics and perfume industry used as a fragrance ingredients, give the product a pleasant aroma.
2. used as an intermediate in the synthesis of drugs, such as anticoagulant drug warfarin synthetic raw materials.
3. used as spice additives in the food industry to increase the aroma of food.
3, the preparation method can be realized by the following methods:
1. coumarin can be synthesized by the reaction of phenolic compounds and cyclic triketone.
2. It can also be prepared by the oxidation reaction of isotryptaminic acid.
Regarding 3, the safety information: Due to the characteristics of chemicals, you need to pay attention to the following matters:
1. 3, it can be decomposed in the air, and oxidation reaction is easy to occur when encountering sunlight and ultraviolet rays.
2. in handling, storage and use, avoid contact with oxidants and strong acids to prevent dangerous reactions.
3. use and storage should wear protective gloves and mask, avoid direct contact with skin and eyes.
4. 3, should be away from fire, stored in a cool, ventilated place.
Please refer to the relevant chemical literature and safety data sheets for further information on the properties, uses, methods and safety of 3.
Last Update：2024-04-09 20:02:46
