2,2-DIPHENYLETHANOL
2,2-DIPHENYLETHANOL
CAS: 1883-32-5
Molecular Formula: C14H14O
2,2-DIPHENYLETHANOL - Names and Identifiers
| Name | 2,2-DIPHENYLETHANOL |
| Synonyms | 2,2-DIPHENYLETHANOL RARECHEM AL BD 0122 2,2-diphenyl-1-ethanol β-Phenylbenzeneethanol 2,2-diphenylethan-1-ol 2,2-Diphenylethyl alcohol Benzeneethanol, beta-phenyl- beta-phenylphenethyl alcohol |
| CAS | 1883-32-5 |
| EINECS | 217-543-6 |
| InChI | InChI=1/C14H14O/c15-11-14(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10,14-15H,11H2 |
| InChIKey | NYLOEXLAXYHOHH-UHFFFAOYSA-N |
2,2-DIPHENYLETHANOL - Physico-chemical Properties
| Molecular Formula | C14H14O |
| Molar Mass | 198.26 |
| Density | 1.079 |
| Melting Point | 53-56 °C (lit.) |
| Boling Point | 190-192 °C/12 mmHg (lit.) |
| Flash Point | >230°F |
| Vapor Presure | 8.14E-05mmHg at 25°C |
| Appearance | Crystalline Powder |
| Color | White |
| pKa | 14.62±0.10(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| Stability | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Refractive Index | 1.5680 (estimate) |
2,2-DIPHENYLETHANOL - Risk and Safety
| Hazard Symbols | Xi - Irritant |
| WGK Germany | 3 |
| HS Code | 29062900 |
| Hazard Class | IRRITANT |
2,2-DIPHENYLETHANOL - Reference Information
| Use | 2, 2-diphenylethanol can be used as a pharmaceutical synthesis intermediate. |
| hazardous management | if inhaling 2, 2-diphenylethanol, move the patient to fresh air; If skin contact, should remove contaminated clothing, with soap and water thoroughly rinse the skin, if there is discomfort, medical treatment; If the eyes contact, should separate the eyelids, with running water or saline, and immediately seek medical treatment; if the food, immediately gargle, prohibit emetic, should immediately see a doctor. |
Last Update：2024-04-09 21:11:58
