2,3,4-tri-O-benzyl-5-O-prop-2-en-1-yl-D-ribitol - Names and Identifiers
Name | 5-O-Allyl-2,3,4-tri-O-benzyl-D-ribitol
|
Synonyms | 5-O-Allyl-2,3,4-O-benzyl-D-ribitol 5-O-Allyl-2,3,4-tri-O-benzyl-D-ribito 5-O-ALLYL-2,3,4-TRI-O-BENZYL-D-RIBITOL 5-O-Allyl-2,3,4-tri-O-benzyl-D-ribitol 2,3,4-tri-O-benzyl-5-O-prop-2-en-1-yl-D-ribitol 2,3,4-Tris-O-(phenylmethyl)-5-O-2-propenyl-D-ribitol (2S,3S,4R)-5-(Allyloxy)-2,3,4-tris(benzyloxy)pentan-1-ol D-Ribitol, 2,3,4-tris-O-(phenylmethyl)-5-O-2-propen-1-yl- (2S,3S,4R)-2,3,4-tris(benzyloxy)-5-(prop-2-en-1-yloxy)pentan-1-ol
|
CAS | 111549-97-4
|
InChI | InChI=1/C29H34O5/c1-2-18-31-23-28(33-21-25-14-8-4-9-15-25)29(34-22-26-16-10-5-11-17-26)27(19-30)32-20-24-12-6-3-7-13-24/h2-17,27-30H,1,18-23H2/t27-,28+,29-/m0/s1 |
2,3,4-tri-O-benzyl-5-O-prop-2-en-1-yl-D-ribitol - Physico-chemical Properties
Molecular Formula | C29H34O5
|
Molar Mass | 462.58 |
Density | 1.124 |
Boling Point | 592.3±50.0 °C(Predicted) |
Flash Point | 312°C |
Vapor Presure | 7.12E-15mmHg at 25°C |
pKa | 14.13±0.10(Predicted) |
Storage Condition | 2-8°C |
Refractive Index | 1.568 |
2,3,4-tri-O-benzyl-5-O-prop-2-en-1-yl-D-ribitol - Introduction
5-O-allyl-2, 3,4-tri-O-benzyl-D-ribitol is an organic compound with the following properties:
1. Appearance: colorless crystalline solid.
2. Solubility: Soluble in some organic solvents such as ethanol, dichloromethane, etc.
3. stability: relatively stable at room temperature, but need to avoid light, avoid heat and avoid contact with oxygen to prevent decomposition.
5-O-allyl-2, 3,4-tri-O-benzyl-D-ribitol has the following uses:
1. Academic research: As a synthetic intermediate of organic compounds, it has applications in the field of organic synthesis and pharmaceutical research.
2. pharmaceutical industry: can be used as a key synthetic raw material for some drugs, such as anti-cancer drugs.
5-O-allyl-2, 3,4-tri-O-benzyl-D-ribitol preparation method is more complex, generally involving multi-step organic synthesis reaction, need to use specific reagents and conditions. The specific preparation method can be found through the organic chemical synthesis literature or consult the researchers in the field of professional chemistry.
Regarding its safety information, due to the lack of specific safety data, it is impossible to provide a detailed assessment. However, the synthesis and application of organic compounds may involve some potential safety risks, such as toxicity or dangerousness. Therefore, when handling or handling the compound, you should follow laboratory and chemical safety procedures, wear appropriate personal protective equipment, and ensure that the experiment is carried out under appropriate conditions. In addition, if it is necessary to use or handle this compound, it is best to refer to the relevant chemical literature or professional safety data and operating instructions to ensure safety.
Last Update:2024-04-09 21:32:36