2,3-Dichloro-4-hydroxybenzaldehyde

2,3-Dichloro-4-hydroxybenzaldehyde - Names and Identifiers

Name	2,3-Dichloro-4-hydroxybenzaldehyde
Synonyms	2,3-Dichloro-4-formylphenol 2,3-DICHLORO-4-HYDROXYBENZALDEHYDE 2,3-Dichloro-4-hydroxybenzaldehyde Benzaldehyde,2,3-dichloro-4-hydroxy-
CAS	16861-22-6
InChI	InChI=1/C7H4Cl2O2/c8-6-4(3-10)1-2-5(11)7(6)9/h1-3,11H

2,3-Dichloro-4-hydroxybenzaldehyde - Physico-chemical Properties

Molecular Formula	C7H4Cl2O2
Molar Mass	191.01
Density	1.547±0.06 g/cm3(Predicted)
Melting Point	184-185 °C
Boling Point	278.6±35.0 °C(Predicted)
Flash Point	122.3°C
Vapor Presure	0.00249mmHg at 25°C
pKa	5.36±0.23(Predicted)
Refractive Index	1.643

2,3-Dichloro-4-hydroxybenzaldehyde - Risk and Safety

Hazard Symbols

Xi - Irritant

2,3-Dichloro-4-hydroxybenzaldehyde - Introduction

2, the chemical formula is C7H5Cl2O2, which is an organic compound. Its properties are as follows:

1. Appearance: 2. It is a white or yellowish crystal or crystalline powder.
2. Solubility: It is difficult to dissolve in water and can be dissolved in alcohol and ether solvents.
3. Melting point and boiling point: its melting point range of 100-103 ℃.
4. Chemical reaction: 2. It can be prepared by the reaction of aldol or the reaction of chlorinated aromatic hydrocarbons.

2, has a wide range of applications in the field of organic synthesis and pharmaceutical chemistry, commonly used in the synthesis of pesticides, pharmaceuticals and dye compounds.

Preparation 2, the method can be carried out by the following steps:
1. P-hydroxybenzaldehyde reacts with Chloroacetyl Chloride to generate 2,3-dichloro-4-hydroxybenzoyl chloride.
2. React 2,3-dichloro-4-hydroxybenzoyl chloride with sodium hydroxide to generate 2.

2. The following safety information should be paid attention to during use:
1. Contact with the skin may cause irritation, should avoid prolonged contact or contact allergic people.
2. Inhalation or ingestion of the compound may have adverse effects on human health, should take appropriate protective measures to avoid inhalation of dust or steam.
3. In use should be sealed to save, avoid contact with air or high humidity environment.

In the process of handling and storage, should strictly abide by the relevant safety procedures and measures. In case of doubt or accident, you should consult or seek professional assistance in time.

Last Update：2024-04-09 19:05:47