2,3-Dichloro-6-nitrobenzenamine
2,3-dichloro-6-nitroaniline
CAS: 65078-77-5
Molecular Formula: C6H4Cl2N2O2
2,3-Dichloro-6-nitrobenzenamine - Names and Identifiers
| Name | 2,3-dichloro-6-nitroaniline |
| Synonyms | 2,3-Dichloro-6-nitroaniline 2,3-dichloro-6-nitroaniline 2,3-Dichloro-6-nitrobenzenamine Benzenamine,2,3-dichloro-6-nitro- |
| CAS | 65078-77-5 |
| EINECS | 265-378-3 |
| InChI | InChI=1/C6H4Cl2N2O2/c7-3-1-2-4(10(11)12)6(9)5(3)8/h1-2H,9H2 |
2,3-Dichloro-6-nitrobenzenamine - Physico-chemical Properties
| Molecular Formula | C6H4Cl2N2O2 |
| Molar Mass | 207.01 |
| Density | 1.624g/cm3 |
| Boling Point | 323.5°C at 760 mmHg |
| Flash Point | 149.4°C |
| Vapor Presure | 0.000261mmHg at 25°C |
| Storage Condition | 2-8°C(protect from light) |
| Refractive Index | 1.655 |
2,3-Dichloro-6-nitrobenzenamine - Introduction
2,3-dichloro-6-nitroaniline, abbreviated as DCNA, is an organic compound. The following is a description of its nature, use, formulation and safety information:
Nature:
1. Appearance: colorless or light yellow crystal
2. molecular formula: C6H4Cl2N2O2
3. Molecular weight: 202.01g/mol
4. Melting point: 102-105°C
5. Boiling point: 289-292°C
6. Solubility: slightly soluble in water, soluble in organic solvents such as ethanol and ether
7. Chemical properties: DCNA is a compound containing chlorine and nitro groups, which can be reduced to the corresponding amine compounds.
Use:
1. DCNA is an important dye intermediate, which can be used to synthesize dyes and pigments.
2. It can also be used to prepare some compounds in the field of pesticides and medicines.
Preparation Method:
The synthesis of DCNA is usually prepared by nitrating aniline. First, under appropriate conditions, aniline is reacted with concentrated nitric acid to obtain o-nitroaniline. Subsequently, p-nitroaniline is subjected to dichlorination to give 2,3-dichloro-6-nitroaniline.
Safety Information:
1. DCNA is a toxic substance that may pose a health hazard by exposure or inhalation. Wear appropriate protective measures such as gloves and goggles during operation.
2. Avoid contact with strong oxidants and reducing agents to avoid violent reactions.
3. should be stored in a closed container, away from heat and fire sources.
4. When handling and using, please follow the relevant safety procedures and ensure proper ventilation and explosion-proof measures. Do not expose it to open flame or high temperature to avoid fire or explosion.
Nature:
1. Appearance: colorless or light yellow crystal
2. molecular formula: C6H4Cl2N2O2
3. Molecular weight: 202.01g/mol
4. Melting point: 102-105°C
5. Boiling point: 289-292°C
6. Solubility: slightly soluble in water, soluble in organic solvents such as ethanol and ether
7. Chemical properties: DCNA is a compound containing chlorine and nitro groups, which can be reduced to the corresponding amine compounds.
Use:
1. DCNA is an important dye intermediate, which can be used to synthesize dyes and pigments.
2. It can also be used to prepare some compounds in the field of pesticides and medicines.
Preparation Method:
The synthesis of DCNA is usually prepared by nitrating aniline. First, under appropriate conditions, aniline is reacted with concentrated nitric acid to obtain o-nitroaniline. Subsequently, p-nitroaniline is subjected to dichlorination to give 2,3-dichloro-6-nitroaniline.
Safety Information:
1. DCNA is a toxic substance that may pose a health hazard by exposure or inhalation. Wear appropriate protective measures such as gloves and goggles during operation.
2. Avoid contact with strong oxidants and reducing agents to avoid violent reactions.
3. should be stored in a closed container, away from heat and fire sources.
4. When handling and using, please follow the relevant safety procedures and ensure proper ventilation and explosion-proof measures. Do not expose it to open flame or high temperature to avoid fire or explosion.
Last Update：2024-04-09 21:01:54
