2,3-dihydro-5,6-dimethoxy-1H-Isoindol-1-one

2,3-dihydro-5,6-dimethoxy-1H-Isoindol-1-one - Names and Identifiers

Name	5,6-Dimethoxy-1-isoindolinone
Synonyms	5,6-Dimethoxy-1-isoindolinone 5,6-diMethoxyisoindolin-1-one 5,6-DIMETHOXY-2,3-DIHYDRO-ISOINDOL-1-ONE 2,3-dihydro-5,6-dimethoxy-1H-Isoindol-1-one 5,6-Dimethoxy-2,3-dihydro-1H-isoindol-1-one 1H-Isoindol-1-one, 2,3-dihydro-5,6-dimethoxy- 1H-Isoindol-1-one, 2,3-dihydro-5,6-diMethoxy-
CAS	59084-72-9
InChI	InChI=1S/C10H11NO3/c1-13-8-3-6-5-11-10(12)7(6)4-9(8)14-2/h3-4H,5H2,1-2H3,(H,11,12)

2,3-dihydro-5,6-dimethoxy-1H-Isoindol-1-one - Physico-chemical Properties

Molecular Formula	C10H11NO3
Molar Mass	193.2
Density	1.214±0.06 g/cm3(Predicted)
Melting Point	233 - 235°C
Boling Point	464.5±45.0 °C(Predicted)
Solubility	Chloroform (Slightly). Methanol (Slightly)
Appearance	Solid
Color	Pale Beige to Light Beige
pKa	13.71±0.20(Predicted)
Storage Condition	Inert atmosphere,Room Temperature

2,3-dihydro-5,6-dimethoxy-1H-Isoindol-1-one - Introduction

5,6-dimethoxy-1-isoindolinone, also known as 5,6-dimethoxy-1-isoindolinone, is an organic compound.

its nature:
1. Appearance: A solid with white to light yellow crystals or powder.
2. molecular formula: C12H13NO3.
3. Molecular weight: 219.24g/mol.
4. Melting point: about 144-146 degrees Celsius.
5. Solubility: Dissolved in anhydrous organic solvent. Low solubility in water.

Its purpose:
1. Chemical synthesis: 5,6-dimethoxy-1-isoindolinone is commonly used as an intermediate in organic synthesis and can be used to synthesize other organic compounds.
2. Drug research: The derivatives of the compound are used in the field of drug research to explore their potential in anti-cancer, anti-virus and anti-bacterial.

its preparation method:
5,6-Dimethoxy-1-isoindolinone can be synthesized by a variety of methods. Common synthesis methods include the following:
1. Using 2,3-dihydro -5,6-dimethoxypyridine as starting material, the target compound was synthesized by oxidation and ring-closing reaction.
2. Using 2,3-dihydro -5,6-dimethoxypyridine as the starting material, the esterification compound similar to the structure of the target compound was prepared by esterification reaction, and then the target compound was obtained by deprotection and amidation reaction.

Safety Information:
1. Limited information is available on the toxicity and risk of 5,6-dimethoxy-1-isoindolinone. However, as a synthetic intermediate, it may have some irritation and toxicity.
2. use should take appropriate safety measures, such as wearing protective gloves, goggles and protective clothing, avoid contact with skin, eyes and respiratory tract. Good ventilation should be ensured during operation.

Last Update：2024-04-09 20:45:29