2,4,5-Triamino-pyridine - Names and Identifiers
Name | 2,4,5-Triaminopyridine
|
Synonyms | 2,4,5-Triaminopyridine 2,4,5-Pyridinetriamine 2,4,5-pyridinetriamine pyridine-2,4,5-triaMine 2,4,5-Triamino-pyridine Pyridine-2,4,5-triamine 2,4,5-TriaMinopyridine hydrochloride
|
CAS | 23244-87-3
|
InChI | InChI=1/C5H8N4/c6-3-1-5(8)9-2-4(3)7/h1-2H,7H2,(H4,6,8,9) |
2,4,5-Triamino-pyridine - Physico-chemical Properties
Molecular Formula | C5H8N4
|
Molar Mass | 124.14 |
Density | 1.387±0.06 g/cm3(Predicted) |
Boling Point | 453.2±40.0 °C(Predicted) |
Flash Point | 258.501°C |
Vapor Presure | 0mmHg at 25°C |
pKa | 9.23±0.24(Predicted) |
Storage Condition | under inert gas (nitrogen or Argon) at 2–8 °C |
Refractive Index | 1.766 |
2,4,5-Triamino-pyridine - Introduction
2,4,5-Triaminopyridine(2,4,5-Triaminopyridine) is an organic compound with the chemical formula C5H8N4. The following is a description of its nature, use, preparation and safety information:
Nature:
1. Appearance: 2,4,5-Triaminopyridine is a white solid or crystal.
2. Solubility: It is almost insoluble in water, but soluble in acid and organic solvents such as ethanol, ether, etc.
Use:
1. 2,4,5-Triaminopyridine can be used as a metal coordination ligand and has important applications in coordination chemistry.
2. It can also be used as a catalyst and reaction intermediates in organic synthesis, such as nucleophilic substitution reactions and carbonylation reactions.
3. In the medical field, 2,4,5-Triaminopyridine can be used to synthesize drugs or drug intermediates.
Method:
2,4,5-Triaminopyridine can be prepared by reducing pyridine-2, 4,5-tricarboxylic acid or its derivatives to obtain the target product. The specific preparation method can be selected according to different literature reports.
Safety Information:
1. 2,4,5-Triaminopyridine is generally considered to be a relatively safe compound, but as a chemical reagent, the following safety matters should be paid attention:
2. When handling the compound, Good Laboratory safety measures should be taken, such as wearing appropriate personal protective equipment (such as gloves, protective glasses).
3. Avoid inhalation of dust or solution, avoid contact with skin and eyes.
4. If you come into contact with this compound, rinse immediately with plenty of water and seek medical help.
5. Local regulations and codes should be followed in proper storage and handling of the compound.
Please note that when using any chemicals, you should carefully read and follow the relevant safety information and operating instructions, and use appropriate protective measures, to ensure personal and environmental safety.
Last Update:2024-04-09 15:17:56