2,4-Diaminodiphenylamine
2,4-Diaminodiphenylamine
CAS: 136-17-4
Molecular Formula: C12H13N3
2,4-Diaminodiphenylamine - Names and Identifiers
| Name | 2,4-Diaminodiphenylamine |
| Synonyms | 2,4-DIAMINODIPHENYLAMINE 2,4-Diaminodiphenylamine N-Phenyl-1,2,4-benzenetriamine N'-Phenyl-1,2,4-benzenetriamine N1-phenylbenzene-1,2,4-triamine (2,4-diaminophenyl)-phenyl-amine 4-Phenylaminobenzene-1,3-diamine 1-N-phenylbenzene-1,2,4-triamine N~1~-phenylbenzene-1,2,4-triamine 4-benzenetriamine,n(sup1)-phenyl-2 |
| CAS | 136-17-4 |
| InChI | InChI=1/C12H13N3/c13-9-6-7-12(11(14)8-9)15-10-4-2-1-3-5-10/h1-8,15H,13-14H2 |
2,4-Diaminodiphenylamine - Physico-chemical Properties
| Molecular Formula | C12H13N3 |
| Molar Mass | 199.25 |
| Density | 1.245±0.06 g/cm3(Predicted) |
| Melting Point | 129-131°C |
| Boling Point | 389.1±27.0 °C(Predicted) |
| Flash Point | 223.3°C |
| Vapor Presure | 2.91E-06mmHg at 25°C |
| Appearance | powder to crystal |
| Color | White to Amber to Dark purple |
| pKa | 5.19±0.10(Predicted) |
| Storage Condition | Room Temprature |
| Refractive Index | 1.733 |
| MDL | MFCD00025285 |
| Physical and Chemical Properties | RTECS:DC1954000 |
2,4-Diaminodiphenylamine - Risk and Safety
| Risk Codes | 33 - Danger of cumulative effects |
| UN IDs | UN2811 |
| RTECS | DC1954000 |
| Hazard Class | 6.1 |
| Packing Group | III |
2,4-Diaminodiphenylamine - Introduction
2,4-Diaminodiphenylamine is an organic compound with the chemical formula C12H12N4. It is a white to pale yellow solid with a faint ammoniacal odor. The following is a description of its nature, use, preparation and safety information:
Nature:
1. Appearance: 2,4-diaminodiphenylamine is a white to light yellow solid.
2. Solubility: It is almost insoluble in water, but can be dissolved in organic solvents such as ethanol, toluene, etc.
3. melting point: its melting point is about 205-214 degrees Celsius.
Use:
1. Dyes and pigments: 2,4-diaminodiphenylamine can be used as a raw material for the synthesis of dyes and pigments, and is widely used in the textile, paint and plastics industries.
2. chemical reaction intermediates: it can be used as chemical reaction intermediates for the synthesis of other compounds, such as pharmaceuticals, pesticides and cosmetics.
Preparation Method:
The synthesis of 2,4-diaminodiphenylamine often uses the reaction of aniline and sodium nitrite. First, aniline reacts with sodium nitrite under acidic conditions to produce nitrosoaniline, and then 2,4-diaminodiphenylamine is obtained by reduction reaction.
Safety Information:
1. use should be careful to avoid contact with skin, eyes and respiratory tract. If accidental contact, should be promptly washed with plenty of water, and timely medical treatment.
2. 2,4-diaminodiphenylamine is a toxic substance and should be stored in a sealed container and kept away from fire and high temperature.
3. in the use and storage process should comply with the relevant safety procedures, and wear appropriate protective equipment, such as gloves, glasses and masks.
4. in the treatment of waste should follow the relevant environmental regulations, pay attention to prevent pollution of the environment.
Nature:
1. Appearance: 2,4-diaminodiphenylamine is a white to light yellow solid.
2. Solubility: It is almost insoluble in water, but can be dissolved in organic solvents such as ethanol, toluene, etc.
3. melting point: its melting point is about 205-214 degrees Celsius.
Use:
1. Dyes and pigments: 2,4-diaminodiphenylamine can be used as a raw material for the synthesis of dyes and pigments, and is widely used in the textile, paint and plastics industries.
2. chemical reaction intermediates: it can be used as chemical reaction intermediates for the synthesis of other compounds, such as pharmaceuticals, pesticides and cosmetics.
Preparation Method:
The synthesis of 2,4-diaminodiphenylamine often uses the reaction of aniline and sodium nitrite. First, aniline reacts with sodium nitrite under acidic conditions to produce nitrosoaniline, and then 2,4-diaminodiphenylamine is obtained by reduction reaction.
Safety Information:
1. use should be careful to avoid contact with skin, eyes and respiratory tract. If accidental contact, should be promptly washed with plenty of water, and timely medical treatment.
2. 2,4-diaminodiphenylamine is a toxic substance and should be stored in a sealed container and kept away from fire and high temperature.
3. in the use and storage process should comply with the relevant safety procedures, and wear appropriate protective equipment, such as gloves, glasses and masks.
4. in the treatment of waste should follow the relevant environmental regulations, pay attention to prevent pollution of the environment.
Last Update：2024-04-09 02:00:42
Supplier List
Product Name: 2,4-Diaminodiphenylamine Visit Supplier Webpage Request for quotation
CAS: 136-17-4
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 136-17-4
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: 2,4-Diaminodiphenylamine Visit Supplier Webpage Request for quotation
CAS: 136-17-4
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 136-17-4
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History