2,4-Dichloro-5-Methyl-7H-... - Names and Identifiers
Name | 2,4-Dichloro-5-methyl-7H-pyrrolo[2,3-d]pyrimidine
|
Synonyms | 2,4-Dichloro-5-Methyl-7H-... 2,4-Dichloro-5-methyl-7H-pyrrolo[2,3-d]pyrimidine 2,4-Dichloro-5-methyl-1H-pyrrolo[2,3-d]pyrimidine 7H-Pyrrolo[2,3-d]pyrimidine, 2,4-dichloro-5-methyl-
|
CAS | 1060815-86-2
|
EINECS | 1308068-626-2 |
InChI | InChI=1S/C7H5Cl2N3/c1-3-2-10-6-4(3)5(8)11-7(9)12-6/h2H,1H3,(H,10,11,12) |
2,4-Dichloro-5-Methyl-7H-... - Physico-chemical Properties
Molecular Formula | C7H5Cl2N3
|
Molar Mass | 202.04 |
Density | 1.572±0.06 g/cm3(Predicted) |
pKa | 10.58±0.50(Predicted) |
Storage Condition | under inert gas (nitrogen or Argon) at 2-8°C |
2,4-Dichloro-5-Methyl-7H-... - Introduction
2,4-Dichloro-5-methyl-7H-pyrrole [2,3-D] pyrimidine, also known as DPC, is an organic compound. Its molecular formula is C6H4Cl2N2 and its molecular weight is 170.02. The following is a description of some of the properties, uses, methods and safety information about DPC:
Nature:
1. Appearance: White crystalline solid.
2. Solubility: DPC is soluble in most commonly used solvents, such as ethanol, acetone, dimethylformamide, etc.
3. Melting point: The melting point of DPC is about 150-152°C.
4. Stability: DPC is stable at room temperature, but can react violently with some strong oxidants.
Use:
1. Pesticide: DPC is a broad-spectrum fungicide, which can kill a variety of plant pathogens and fungi.
2. chemical synthesis: DPC can be used as an important starting material in organic synthesis, and can be used as a reagent or reagent intermediate in some organic reactions.
Preparation Method:
DPC is prepared by chlorination of pyrrole [2,3-D] pyrimidine. The specific preparation method can refer to the experimental teaching materials of organic chemistry synthesis or related literature.
Safety Information:
1. toxicity: DPC has certain toxicity to the environment and organisms, and the specific toxicity depends on the concentration and contact route.
2. Dangers: DPC is irritating, avoid contact with skin, eyes and respiratory tract. Personal protection during operation.
3. Storage: DPC should be stored in a dry, well-ventilated place, away from fire and direct sunlight.
4. Disposal: Waste and residues should be disposed of properly in accordance with local regulations.
Please note that proper laboratory practices and safety measures should be followed when using and handling chemicals. The appropriate safety guidelines should be followed when using the DPC.
Last Update:2024-04-10 22:29:15