2,4-Dichloro-6-broMoquinazoline

2,4-Dichloro-6-broMoquinazoline - Names and Identifiers

Name	6-Bromo-2,4-dichloroquinazoline
Synonyms	4-dichloroquinazoline 6-Bromo-2,4-dichloroquina... 6-broMo-2,4-dichlroquinazoline 2,4-Dichloro-6-broMoquinazoline 6-BROMO-2,4-DICHLOROQUINAZOLINE 2,4-Dichloro-6-bromoquinazoline 6-Bromo-2,4-dichloroquinazoline Quinazoline, 6-bromo-2,4-dichloro-
CAS	102393-82-8
InChI	InChI=1/C8H3BrCl2N2/c9-4-1-2-6-5(3-4)7(10)13-8(11)12-6/h1-3H

2,4-Dichloro-6-broMoquinazoline - Physico-chemical Properties

Molecular Formula	C8H3BrCl2N2
Molar Mass	277.93
Density	1.851±0.06 g/cm3(Predicted)
Boling Point	330.2±24.0 °C(Predicted)
Flash Point	153.473°C
Water Solubility	Slightly soluble in water.
Vapor Presure	0mmHg at 25°C
Appearance	Solid
Color	Off-white
pKa	-1.19±0.30(Predicted)
Storage Condition	Inert atmosphere,Store in freezer, under -20°C
Refractive Index	1.696

2,4-Dichloro-6-broMoquinazoline - Introduction

6-Bromo-2, 4-dichloroquinazoline is an organic compound with the formula C9H5BrCl2N2. Its properties include:

1. Appearance: colorless to light yellow crystal or crystalline powder.
2. Solubility: Soluble in organic solvents such as chloroform, ether and alcohol, slightly soluble in water.
3. melting point: about 120-121 degrees Celsius.

6-Bromo-2, 4-dichloroquinazoline has a wide range of uses in the field of medicine and pesticides:

1. Pesticide: It is a pesticide that can be used to control insect pests on a variety of crops, such as apples, wheat, citrus, etc.
2. Antibacterial agent: The compound also has certain antibacterial activity and can be used to treat certain infectious diseases.

The method for preparing 6-bromo-2, 4-dichloroquinazoline generally includes the following steps:

1. reaction precursor: need to use 2-chloro-4-benzamidoquinazoline and cuprous bromide as the precursor of the reaction.
2. reaction conditions: in the corresponding reaction solvent, the reaction precursor is brominated to generate 6-bromo-2, 4-dichloroquinazoline.
3. Crystallization and purification: Through the crystallization process and appropriate purification steps, a higher purity product is obtained.

Regarding safety information, here are some things to note:

1. Wear protective gloves, glasses and masks during operation to avoid direct contact and inhalation.
2. Avoid ingestion, inhalation and skin contact of the compound.
3. When using and storing, keep away from fire and heat sources to avoid fire and explosion.
4. Please keep the compound properly and avoid mixing or mixing with other chemicals to avoid dangerous reactions.
5. If an accident occurs, seek medical attention immediately and bring information about the compound.

Please note that the use and handling of 6-bromo-2, 4-dichloroquinazoline should strictly comply with relevant safety regulations.

Last Update：2024-04-09 21:21:28