2,5-diphenylpyridine-4-Methyl
4-methyl-2,5-diphenylpyridine
CAS: 156021-08-8
Molecular Formula: C18H15N
2,5-diphenylpyridine-4-Methyl - Names and Identifiers
| Name | 4-methyl-2,5-diphenylpyridine |
| Synonyms | LogP TC-OM-11 -Methyl-2,5-diphenylpyridine 2,5-diphenylpyridine-4-Methyl 4-Methyl-2,5-diphenylpyridine 4-methyl-2,5-diphenylpyridine Pyridine, 4-methyl-2,5-diphenyl- |
| CAS | 156021-08-8 |
| InChI | InChI=1/C18H15N/c1-14-12-18(16-10-6-3-7-11-16)19-13-17(14)15-8-4-2-5-9-15/h2-13H,1H3 |
| InChIKey | YHQCNNMCDMYPIA-UHFFFAOYSA-N |
2,5-diphenylpyridine-4-Methyl - Physico-chemical Properties
| Molecular Formula | C18H15N |
| Molar Mass | 245.32 |
| Density | 1.068 |
| Melting Point | 127.0 to 131.0 °C |
| Boling Point | 399℃ |
| Flash Point | 175℃ |
| Vapor Presure | 3.28E-06mmHg at 25°C |
| Appearance | powder to crystal |
| Color | White to Orange to Green |
| pKa | 4.68±0.18(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| Sensitive | IRRITANT |
| Refractive Index | 1.598 |
| MDL | MFCD13152024 |
2,5-diphenylpyridine-4-Methyl - Reference Information
| Uses | 4-methyl-2, 5-diphenylpyridine is used in organic synthesis, material intermediates, etc. |
Last Update：2024-04-09 20:45:29
