2,6-Bis(2-thienylmethylene)cyclohexanone
Tenylidone
CAS: 893-01-6
Molecular Formula: C16H14OS2
2,6-Bis(2-thienylmethylene)cyclohexanone - Names and Identifiers
| Name | Tenylidone |
| Synonyms | 212-969-9 tenylidone Tenylidone 2,6-Bis(2-thienylmethylene)cyclohexanone 2,6-bis(thiophen-2-ylmethylidene)cyclohexanone (2E,6E)-2,6-bis(thiophen-2-ylmethylidene)cyclohexanone |
| CAS | 893-01-6 |
| EINECS | 212-969-9 |
| InChI | InChI=1/C16H14OS2/c17-16-12(10-14-6-2-8-18-14)4-1-5-13(16)11-15-7-3-9-19-15/h2-3,6-11H,1,4-5H2/b12-10+,13-11+ |
2,6-Bis(2-thienylmethylene)cyclohexanone - Physico-chemical Properties
| Molecular Formula | C16H14OS2 |
| Molar Mass | 286.41 |
| Density | 1.316g/cm3 |
| Boling Point | 488.2°C at 760 mmHg |
| Flash Point | 249.1°C |
| Vapor Presure | 1.11E-09mmHg at 25°C |
| Refractive Index | 1.719 |
2,6-Bis(2-thienylmethylene)cyclohexanone - Introduction
Tenylidone(Tenylidone), also known as propanedione sulfonamide (-1-m), is an organic compound. The following is a description of the nature, use, manufacture and safety information of the Tenylidone:
1. nature:
- Tenylidone is a white crystalline solid, soluble in polar solvents such as ethanol and methylene chloride.
-It has high thermal and chemical stability.
2. use:
- Tenylidone are commonly used as pharmaceutical intermediates for the synthesis of biologically active compounds.
-It is an important intermediate for the synthesis of drugs such as atorvastatin (Atorvastatin) and perindopril (Perindopril).
3. preparation method:
- Tenylidone can be obtained by the reaction of p-methylbenzenesulfonamide and acetone. The specific synthesis process can refer to organic synthesis literature or technical manuals.
4. Safety Information:
-The Tenylidone has low toxicity under normal operating conditions.
-It may decompose under high temperature and light to produce toxic gases.
-When using Tenylidone, it is recommended to follow correct laboratory practices and wear appropriate personal protective equipment, such as gloves and goggles.
1. nature:
- Tenylidone is a white crystalline solid, soluble in polar solvents such as ethanol and methylene chloride.
-It has high thermal and chemical stability.
2. use:
- Tenylidone are commonly used as pharmaceutical intermediates for the synthesis of biologically active compounds.
-It is an important intermediate for the synthesis of drugs such as atorvastatin (Atorvastatin) and perindopril (Perindopril).
3. preparation method:
- Tenylidone can be obtained by the reaction of p-methylbenzenesulfonamide and acetone. The specific synthesis process can refer to organic synthesis literature or technical manuals.
4. Safety Information:
-The Tenylidone has low toxicity under normal operating conditions.
-It may decompose under high temperature and light to produce toxic gases.
-When using Tenylidone, it is recommended to follow correct laboratory practices and wear appropriate personal protective equipment, such as gloves and goggles.
Last Update：2024-04-09 15:18:00
Supplier List
View History