2,6-Dibromo-4-methoxytoluene

2,6-Dibromo-4-methoxytoluene - Names and Identifiers

Name	2,6-Dibromo-4-methoxytoluene
Synonyms	Einecs 238-576-2 3,5-Dibromo-4-methylanisole 2,6-Dibromo-4-methoxytoluene Anisole, 3,5-dibromo-4-methyl- 1,3-Dibromo-5-methoxy-2-methylbenzene 1,3-dibromo-5-methoxy-2-methylbenzene 3,5-Dibromo-4-methyl-1-methoxybenzene Anisole,3,5-dibromo-4-methyl- (7CI,8CI) Anisole,3,5-dibroMo-4-Methyl- (7CI,8CI) Benzene, 1,3-dibroMo-5-Methoxy-2-Methyl-
CAS	14542-71-3
EINECS	238-576-2
InChI	InChI=1/C8H8Br2O/c1-5-7(9)3-6(11-2)4-8(5)10/h3-4H,1-2H3

2,6-Dibromo-4-methoxytoluene - Physico-chemical Properties

Molecular Formula	C8H8Br2O
Molar Mass	279.96
Density	1.727±0.06 g/cm3(Predicted)
Boling Point	271.1±35.0 °C(Predicted)
Flash Point	107.6°C
Vapor Presure	0.0109mmHg at 25°C
Storage Condition	Sealed in dry,Room Temperature
Refractive Index	1.569

2,6-Dibromo-4-methoxytoluene - Introduction

2, the chemical formula is C8H8Br2O, commonly abbreviated as DBM. It is an organic compound with the following properties:

1. Appearance: colorless or yellowish liquid.
2. Melting Point: about 38-40 degrees Celsius.
3. Boiling point: About 186-187 degrees Celsius.
4. Density: about 1.78 g/cm.

2. It has many uses in chemical experiments and industry:

1. Catalyst: As a transition metal ligand catalyst, it is used in organic synthesis reactions. It is often used as an oxidizing and reducing agent in organic synthesis reactions.
2. Fluorescent dye: Because of its good solubility and fluorescence properties, it is commonly used in the fields of chemiluminescence, fluorescent labeling and photosensitive chemistry.
3. Pharmaceutical field: used in the synthesis of intermediates in certain drugs.
4. Photoelectric materials: commonly used in organic photoelectric devices, organic semiconductors, photosensitive materials and biosensors.

2, the preparation method can be carried out by the following steps:

1. Toluene is reacted with bromine in a reaction solvent to obtain 2,6-dibromomethylbenzene.
2. React 2,6-dibromomethyl with methanol to generate 2 benzene in the presence of an appropriate catalyst.

When using 2, you need to pay attention to the following safety information:

1. It is an organic compound with certain toxicity and irritation. Wear appropriate protective gloves, glasses and protective clothing during use.
2. Avoid inhalation of its vapor or contact with the skin and eyes, so as not to cause irritation and damage.
3. During storage and use, keep away from open flames and high temperatures to avoid fire or explosion.
4. When disposing of waste, it should be disposed of in accordance with local regulations to avoid pollution to the environment.

Last Update：2024-04-09 21:21:28