2,6-Dichloro-3-hydroxynitrobenzene
2,4-Dichloro-3-nitrophenol
CAS: 38902-87-3
Molecular Formula: C6H3Cl2NO3
2,6-Dichloro-3-hydroxynitrobenzene - Names and Identifiers
| Name | 2,4-Dichloro-3-nitrophenol |
| Synonyms | 2,4-Dichloro-3-nitro 4-Dichloro-3-nitrophenol 2,4-DICHLORO-3-NITROPHENOL 2,4-Dichloro-3-nitrophenol phenol, 2,4-dichloro-3-nitro- 2,6-Dichloro-3-hydroxynitrobenzene |
| CAS | 38902-87-3 |
| InChI | InChI=1/C6H3Cl2NO3/c7-3-1-2-4(10)5(8)6(3)9(11)12/h1-2,10H |
2,6-Dichloro-3-hydroxynitrobenzene - Physico-chemical Properties
| Molecular Formula | C6H3Cl2NO3 |
| Molar Mass | 208 |
| Density | 1.682g/cm3 |
| Melting Point | 81-82°C |
| Boling Point | 314.5°C at 760 mmHg |
| Flash Point | 144°C |
| Water Solubility | Slightly soluble in water. |
| Vapor Presure | 0.000252mmHg at 25°C |
| Refractive Index | 1.638 |
2,6-Dichloro-3-hydroxynitrobenzene - Risk and Safety
| Hazard Symbols | Xi - Irritant |
| Hazard Class | 6.1 |
2,6-Dichloro-3-hydroxynitrobenzene - Introduction
2,4-Dichloro-3-nitrophenol is an organic compound with the chemical formula C6H3Cl2NO3. Its properties are as follows:
-Appearance: White crystalline solid
-Melting point: about 130-132°C
-Boiling point: about 360°C
-Solubility: Slightly soluble in water, soluble in organic solvents such as ether, benzene and methylene chloride
Its use mainly has the following aspects:
1. As a dye intermediate: 2,4-Dichloro-3-nitrophenol can be used to prepare dyes and pigments for dyeing fibers, leather and wood.
2. As an insecticide: It has bactericidal, insecticidal and antifungal properties, can be used as an insecticide, and is widely used in agriculture.
3. Used in organic synthesis: As an important compound in organic synthesis, it can be used to synthesize other organic compounds, such as drugs and pesticides.
The method of preparing 2,4-Dichloro-3-nitrophenol can be carried out by the following steps:
1. Dissolve 3-nitrophenol in concentrated hydrochloric acid.
2. Dichloromethane and nitric acid were added to react to obtain an organic phase containing 2,4-Dichloro-3-nitrophenol.
3. After the organic phase was separated and dried, 2,4-Dichlororo-3-nitrophenol was obtained.
Regarding safety information, 2,4-Dichloro-3-nitrophenol is a toxic compound that is irritating and corrosive. Contact with skin and eyes may cause discomfort such as pain, itching and redness. Therefore, appropriate protective equipment should be worn during operation, such as gloves, glasses and laboratory clothes. At the same time, it should be used in a well-ventilated place and avoid inhaling its vapor. If contact or accidental ingestion occurs, rinse immediately with plenty of water and seek medical help.
-Appearance: White crystalline solid
-Melting point: about 130-132°C
-Boiling point: about 360°C
-Solubility: Slightly soluble in water, soluble in organic solvents such as ether, benzene and methylene chloride
Its use mainly has the following aspects:
1. As a dye intermediate: 2,4-Dichloro-3-nitrophenol can be used to prepare dyes and pigments for dyeing fibers, leather and wood.
2. As an insecticide: It has bactericidal, insecticidal and antifungal properties, can be used as an insecticide, and is widely used in agriculture.
3. Used in organic synthesis: As an important compound in organic synthesis, it can be used to synthesize other organic compounds, such as drugs and pesticides.
The method of preparing 2,4-Dichloro-3-nitrophenol can be carried out by the following steps:
1. Dissolve 3-nitrophenol in concentrated hydrochloric acid.
2. Dichloromethane and nitric acid were added to react to obtain an organic phase containing 2,4-Dichloro-3-nitrophenol.
3. After the organic phase was separated and dried, 2,4-Dichlororo-3-nitrophenol was obtained.
Regarding safety information, 2,4-Dichloro-3-nitrophenol is a toxic compound that is irritating and corrosive. Contact with skin and eyes may cause discomfort such as pain, itching and redness. Therefore, appropriate protective equipment should be worn during operation, such as gloves, glasses and laboratory clothes. At the same time, it should be used in a well-ventilated place and avoid inhaling its vapor. If contact or accidental ingestion occurs, rinse immediately with plenty of water and seek medical help.
Last Update：2024-04-10 22:41:30
