2,6-Dichloro-4-pyridinecarbonitrile

2,6-Dichloro-4-pyridinecarbonitrile - Names and Identifiers

Name	2,6-Dichloroisonicotinonitrile
Synonyms	4-CYANO-2,6-DICHLOROPYRIDINE 2,6-Dichloro-4-cyanopyridine 2,6-DICHLORO-4-CYANO-PYRIDINE 2,6-Dichloroisonicotinonitrile 2,6-DICHLOROISONICOTINONITRILE 2,6-Dichloro-4-pyridinecarbonitrile 2,6-dichloropyridine-4-carbonitrile 4-PYRIDINECARBONITRILE,2,6-DICHLORO 4-Pyridinecarbonitrile, 2,6-dichloro- 2,6-Dichloroisonicotinonitrile(WX636167) 2,6-dichloro-2-cyano-1,2-dihydropyridine-4-carboxylic acid 2,6-Dichloropyridine-4-carbonitrile, 4-Cyano-2,6-dichloropyridine
CAS	32710-65-9
EINECS	604-596-9
InChI	InChI=1/C6H2Cl2N2/c7-5-1-4(3-9)2-6(8)10-5/h1-2H

2,6-Dichloro-4-pyridinecarbonitrile - Physico-chemical Properties

Molecular Formula	C6H2Cl2N2
Molar Mass	173
Density	1.49±0.1 g/cm3(Predicted)
Melting Point	96 °C
Boling Point	239.4±35.0 °C(Predicted)
Flash Point	98.6°C
Vapor Presure	0.0403mmHg at 25°C
pKa	-4.76±0.10(Predicted)
Storage Condition	under inert gas (nitrogen or Argon) at 2-8°C
Refractive Index	1.587

2,6-Dichloro-4-pyridinecarbonitrile - Risk and Safety

Hazard Symbols	Xi - Irritant
Risk Codes	20/21/22 - Harmful by inhalation, in contact with skin and if swallowed.
Safety Description	S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection.
UN IDs	3439
Hazard Note	Irritant

2,6-Dichloro-4-pyridinecarbonitrile - Introduction

2, is an organic compound with the chemical formula C6H2Cl2N2. Its main properties are as follows:

1. Appearance: 2. It is colorless crystal or white solid.
2. Solubility: It is soluble in organic solvents such as chloroform, dimethylformamide and ethanol, and almost insoluble in water.
3. Melting Point: its melting point is between 138-142 ℃.

2, the main uses of the pill are as follows:

1. Drug intermediates: It can be used as a raw material for the synthesis of some drugs, such as antibiotics, anticancer drugs, etc.
2. Pesticide intermediates: It can be used to synthesize certain pesticide intermediates for plant protection and crop pest control.

The method of making 2, the method is usually through the following steps:

1. First, 2,6-dichloropyridine is reacted with sodium cyanide in a suitable solvent.
2. Then, through appropriate extraction and purification processes, 2.

It should be noted that 2. The use and handling of the pill need to comply with some safety measures:

1. Avoid contact with skin and eyes. If contact occurs, rinse immediately with plenty of water.
2. When using, please wear protective glasses, gloves and protective clothing and other personal protective equipment.
3. Avoid inhalation of its dust or steam, should be in a well-ventilated place to operate.
4. Should be stored away from the fire and oxidant, keep the container sealed, stored in a cool and dry place.

Please note that in the handling of any chemical, the safe handling procedures and instructions for the use of chemicals should always be strictly observed.

Last Update：2024-04-09 21:21:28