2,8,9-TRIOXA-5-AZA-1-BORABICYCLO(3.3.3)UNDECANE
TRIETHANOLAMINE BORATE
CAS: 122-55-4
Molecular Formula: C6H12BNO3
2,8,9-TRIOXA-5-AZA-1-BORABICYCLO(3.3.3)UNDECANE - Names and Identifiers
| Name | TRIETHANOLAMINE BORATE |
| Synonyms | BORATRANE TRIETHANOLAMINE BORATE TRIHYDROXYTRIETHYLAMINE BORATE 2,2',2'-NITRILOTRIETHYL BORATE TRIS(HYDROXYETHYL)AMINE BORATE 2,2',2''-NITRILOTRIETHYL BORATE 2,2',2'-NITRILOTRIETHANOL BORATE 2,2',2''-NITRILOTRIETHANOL BORATE 2,8,9-TRIOXA-5-AZA-1-BORABICYCLO(3.3.3)UNDECANE |
| CAS | 122-55-4 |
| EINECS | 206-003-5 |
| InChI | InChI=1/C6H12BNO3/c1-4-9-7-10-5-2-8(1)3-6-11-7/h1-6H2 |
2,8,9-TRIOXA-5-AZA-1-BORABICYCLO(3.3.3)UNDECANE - Physico-chemical Properties
| Molecular Formula | C6H12BNO3 |
| Molar Mass | 156.98 |
| Density | 1.13g/cm3 |
| Melting Point | 235-237°C(lit.) |
| Boling Point | 149.6°C at 760 mmHg |
| Flash Point | 44.3°C |
| Vapor Presure | 3.99mmHg at 25°C |
| Appearance | White |
| Storage Condition | Room Temprature |
| Sensitive | Easily absorbing moisture |
| Refractive Index | 1.466 |
| MDL | MFCD00003272 |
| Physical and Chemical Properties | WGK Germany:3 RTECS:YJ8968050 |
2,8,9-TRIOXA-5-AZA-1-BORABICYCLO(3.3.3)UNDECANE - Risk and Safety
| Hazard Symbols | Xi - Irritant |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37 - Wear suitable protective clothing and gloves. |
| WGK Germany | 3 |
| RTECS | YJ8968050 |
| FLUKA BRAND F CODES | 10-21 |
2,8,9-TRIOXA-5-AZA-1-BORABICYCLO(3.3.3)UNDECANE - Introduction
Triethanolamine borate, chemical formula C6H15NO3 · H3BO3, is an inorganic compound. It has the following properties:
1. appearance: triethanolamine borate is usually colorless crystals or white powdery solid.
2. Solubility: It can be dissolved in water and soluble in most organic solvents.
3. Hydrophilicity: triethanolamine borate has good hydrophilicity and can form hydrogen bonds with water molecules.
The main uses of triethanolamine borate include the following:
1. As a buffer: It can be used as a buffer in biochemical experiments to help adjust the pH of the solution.
2. ion exchanger: because triethanolamine borate has the nature of ion exchange, it can be used in solid phase extraction and ion exchange chromatography and other analytical techniques.
3. Surfactant: Because of its hydrophilicity and lipophilicity, triethanolamine borate can be used as a surfactant for coatings, detergents, emulsifiers and other products.
The preparation method of triethanolamine borate is generally obtained by reacting triethanolamine with boric acid. Specific synthetic methods can be found in the relevant literature and patents.
Regarding safety information, triethanolamine borate is generally regarded as a relatively safe compound. But in the process of use, still need to pay attention to the following matters:
1. avoid contact with skin and eyes: such as accidental contact, should promptly rinse with plenty of water, and seek medical help.
2. avoid inhalation and swallowing: if inhaled, can be quickly moved to fresh air, and consult a physician. If swallowed, eat plenty of water immediately and seek medical assistance.
3. storage and use precautions: should be stored in a dry, cool, well-ventilated place, away from fire and flammable materials.
when using triethanolamine borate, detailed operation and use guidance should be carried out according to the actual situation in combination with relevant chemical safety manual.
1. appearance: triethanolamine borate is usually colorless crystals or white powdery solid.
2. Solubility: It can be dissolved in water and soluble in most organic solvents.
3. Hydrophilicity: triethanolamine borate has good hydrophilicity and can form hydrogen bonds with water molecules.
The main uses of triethanolamine borate include the following:
1. As a buffer: It can be used as a buffer in biochemical experiments to help adjust the pH of the solution.
2. ion exchanger: because triethanolamine borate has the nature of ion exchange, it can be used in solid phase extraction and ion exchange chromatography and other analytical techniques.
3. Surfactant: Because of its hydrophilicity and lipophilicity, triethanolamine borate can be used as a surfactant for coatings, detergents, emulsifiers and other products.
The preparation method of triethanolamine borate is generally obtained by reacting triethanolamine with boric acid. Specific synthetic methods can be found in the relevant literature and patents.
Regarding safety information, triethanolamine borate is generally regarded as a relatively safe compound. But in the process of use, still need to pay attention to the following matters:
1. avoid contact with skin and eyes: such as accidental contact, should promptly rinse with plenty of water, and seek medical help.
2. avoid inhalation and swallowing: if inhaled, can be quickly moved to fresh air, and consult a physician. If swallowed, eat plenty of water immediately and seek medical assistance.
3. storage and use precautions: should be stored in a dry, cool, well-ventilated place, away from fire and flammable materials.
when using triethanolamine borate, detailed operation and use guidance should be carried out according to the actual situation in combination with relevant chemical safety manual.
Last Update：2024-04-10 22:41:03
Supplier List
View History