2-(1H-IMIDAZOL-2-YL)-PYRIDINE

2-(1H-IMIDAZOL-2-YL)-PYRIDINE - Names and Identifiers

Name	2-(1H-Imidazol-2-Yl)-Pyridine
Synonyms	2-(2-Pyridyl)imidazole 2-(2′-Pyridyl)imidazole 2-(Pyridin-2-yl)imidazole 2-(Imidazol-2-yl)pyridine 2-(1H-IMidazol-2-yl)pyridine 2-(1H-Imidazol-2-yl)pyridine 2-(1H-Imidazol-2-Yl)-Pyridine 2-(1H-IMIDAZOL-2-YL)-PYRIDINE pyridine, 2-(1H-imidazol-2-yl)- Pyridine, 2-(1H-iMidazol-2-yl)-
CAS	18653-75-3
InChI	InChI=1/C8H7N3/c1-2-4-9-7(3-1)8-10-5-6-11-8/h1-6H,(H,10,11)
InChIKey	SZXUTTGMFUSMCE-UHFFFAOYSA-N

2-(1H-IMIDAZOL-2-YL)-PYRIDINE - Physico-chemical Properties

Molecular Formula	C8H7N3
Molar Mass	145.16
Density	1.214±0.06 g/cm3(Predicted)
Melting Point	135-140°C
Boling Point	382.8±15.0 °C(Predicted)
Flash Point	191.5°C
Vapor Presure	1.01E-05mmHg at 25°C
pKa	pK1:8.98(+1) (25°C,μ=0.005)
Storage Condition	Inert atmosphere,Room Temperature
Refractive Index	1.61
MDL	MFCD05863221

2-(1H-IMIDAZOL-2-YL)-PYRIDINE - Risk and Safety

Hazard Symbols	Xn - Harmful
Risk Codes	22 - Harmful if swallowed
WGK Germany	3

2-(1H-IMIDAZOL-2-YL)-PYRIDINE - Introduction

2-(1H-Imidazol-2-Yl)-Pyridine(2-(imidazol-2-yl)pyridine) is an organic compound with the following properties:

1. Appearance: colorless or light yellow crystal or powder solid.
2. Solubility: Soluble in ethanol and Ether solvents, slightly soluble in water.
3. Melting Point: about 135-138 degrees Celsius.

Use of 2-(1H-Imidazol-2-Yl)-Pyridine:

1. As a catalyst: 2-(1H-Imidazol-2-Yl)-Pyridine can be used as a catalyst in organic synthesis reactions, such as oxidation reaction, carbonylation reaction and alcohol ether interconversion reaction.
2. As a ligand: 2-(1H-Imidazol-2-Yl)-Pyridine can be used as a ligand of metal complexes to participate in the synthesis of catalysts and catalyst precursors.
3. Other applications: 2-(1H-Imidazol-2-Yl)-Pyridine can also be used in the fields of drug synthesis, dye synthesis and surfactant.

Preparation method: 2-(1H-Imidazol-2-Yl)-Pyridine can be prepared by a condensation reaction of Pyridine and 2-cyano-2-propenol or 2-cyano-2-arylacetic acid.

Safety Information:

1. 2-(1H-Imidazol-2-Yl)-Pyridine is relatively stable at room temperature, but it is necessary to avoid sun exposure and high temperature to prevent its decomposition or volatilization.
2. During operation, avoid contact with skin and eyes, and wear protective gloves and goggles if necessary.
3. 2-(1H-Imidazol-2-Yl)-Pyridine is a general organic compound and should be properly stored and handled to avoid contact with oxidants and strong acids.
4. In the process of use, should follow the relevant safety operation specification and laboratory safety guidance.

Last Update：2024-04-09 02:00:43