Name | 2-Acetyl-5-Bromo-6-Methoxynaphthalene |
Synonyms | 2-ACETYL-5-BROMO-6-METHOXYNAPHTHALENE 2-Acetyl-5-Bromo-6-Methoxynaphthalene 5'-BROMO-6'-METHOXY-2'-ACETONAPHTHONE 6-ACETYL-1-BROMO-2-METHOXYNAPHTHALENE 1-(5-bromo-6-methoxynaphthalen-2-yl)ethanone Ethanone, 1-(5-bromo-6-methoxy-2-naphthalenyl)- |
CAS | 84167-74-8 |
InChI | InChI=1/C13H11BrO2/c1-8(15)9-3-5-11-10(7-9)4-6-12(16-2)13(11)14/h3-7H,1-2H3 |
Molecular Formula | C13H11BrO2 |
Molar Mass | 279.13 |
Density | 1.429g/cm3 |
Boling Point | 389°C at 760 mmHg |
Flash Point | 189.1°C |
Vapor Presure | 2.94E-06mmHg at 25°C |
Storage Condition | 2-8℃ |
Refractive Index | 1.618 |
MDL | MFCD00100832 |
Use | Used as a pharmaceutical intermediate for the synthesis of nabumetone |
use | used as a pharmaceutical intermediate for the synthesis of nabumetone |