2-Amino-2-carboxydiphenylsulphide

2-Amino-2-carboxydiphenylsulphide - Names and Identifiers

Name	2-[(2-aminophenyl)sulfanyl]benzoic acid
Synonyms	LogP 2-Amino-2-carboxydiphenylsulphide 2-Amino-2-Carboxydiphenylsulphide benzoic acid, 2-[(2-aminophenyl)thio]- Benzoic acid, 2-[(2-aminophenyl)thio]- 2-(2-Amino-phenylsulfanyl)-benzoic acid 2-[(2-aminophenyl)sulfanyl]benzoic acid
CAS	54920-98-8
InChI	InChI=1/C13H11NO2S/c14-10-6-2-4-8-12(10)17-11-7-3-1-5-9(11)13(15)16/h1-8H,14H2,(H,15,16)

2-Amino-2-carboxydiphenylsulphide - Physico-chemical Properties

Molecular Formula	C13H11NO2S
Molar Mass	245.3
Density	1.37±0.1 g/cm3(Predicted)
Melting Point	156-157.5 °C
Boling Point	413.0±30.0 °C(Predicted)
Flash Point	203.577°C
Vapor Presure	0mmHg at 25°C
pKa	3.41±0.36(Predicted)
Storage Condition	2-8°C
Refractive Index	1.706

2-Amino-2-carboxydiphenylsulphide - Introduction

2-[(2-aminophenyl)sulfanyl]benzoic acid, the chemical formula is Cover H0.3 NO S, is an organic compound. Its nature is as follows:

1. Appearance: 2-[(2-aminophenyl)sulfanyl]benzoic acid is yellow to orange crystal or crystalline powder;
2. solubility: soluble in anhydrous ethanol and dimethyl sulfoxide, slightly soluble in chloroform, ether and petroleum ether, almost insoluble in water;
3. Melting point: about 150-152°C.

2-[(2-aminophenyl)sulfanyl]benzoic acid is often used as a raw material and intermediate in organic synthesis. It has a wide range of applications in medicinal chemistry and dye industry, including the synthesis of benzoic acid drugs, dyes and functional materials.

One of the main methods for preparing 2-[(2-aminophenyl)sulfanyl]benzoic acid is generated by the reaction of an aminothio compound and terephthalic anhydride. The specific preparation method is as follows:

1. the reaction of nitrothiophenol with sodium hydroxide to generate sodium nitrothiophenol.
2. Oxidation of sodium nitrothiophenol with excess sodium hypochlorite to obtain thiophenol dinitrophenol.
3. reacting thiophenol dinitrophenol with excess sodium hypochlorite to generate dinitrodiphenyl dithiophenol.
4. Boil dinitrodiphenyl dithiol with steam to reduce it to diaminodiphenyl dithiol.
5. coupling reaction of diaminodiphenyl dithiol with 5-aminosalicylic anhydride to generate 2-[(2-aminophenyl)sulfanyl]benzoic acid.

In the process of using and handling 2-[(2-aminophenyl)sulfanyl]benzoic acid, you need to pay attention to the following safety information:
1. Avoid inhalation, contact with skin or use. Wear suitable protective equipment such as gloves, goggles and protective clothing during operation.
2. Use should be carried out in a well-ventilated place to avoid excessive vapor concentration.
3. storage should be kept in a dry, cool, away from the fire and oxidant place.
4. Waste disposal shall be carried out in accordance with local regulations and environmental protection requirements.

Last Update：2024-04-09 19:05:50