2-Amino-6-bromo-3-hydroxypyridine
2-Amino-6-bromo-3-pyridinol
CAS: 934758-27-7
Molecular Formula: C5H5BrN2O
2-Amino-6-bromo-3-hydroxypyridine - Names and Identifiers
| Name | 2-Amino-6-bromo-3-pyridinol |
| Synonyms | 2-Amino-6-bromo-3-pyridinol 2-AMINO-6-BROMOPYRIDIN-3-OL 3-Pyridinol, 2-amino-6-bromo- 2-Amino-6-bromo-3-hydroxypyridine |
| CAS | 934758-27-7 |
| InChI | InChI=1S/C5H5BrN2O/c6-4-2-1-3(9)5(7)8-4/h1-2,9H,(H2,7,8) |
2-Amino-6-bromo-3-hydroxypyridine - Physico-chemical Properties
| Molecular Formula | C5H5BrN2O |
| Molar Mass | 189.01 |
| Density | 1.898 |
| Boling Point | 421.3±45.0 °C(Predicted) |
| pKa | 4.59±0.23(Predicted) |
| Storage Condition | under inert gas (nitrogen or Argon) at 2–8 °C |
2-Amino-6-bromo-3-hydroxypyridine - Introduction
It is an organic compound with the following properties:
1. Appearance: colorless crystal or white crystalline powder.
2. molecular formula: C5H5BrN2O
3. Molecular weight: 174.01g/mol
4. melting point: 135-139 degrees Celsius
5. solubility: slightly soluble in water, soluble in organic solvents.
The main uses of the pill include:
1. pesticide: as an intermediate of pesticides and herbicides.
2. drugs: intermediates for the synthesis of antimalarial drugs and other drugs.
3. Other applications: catalysts and complexing reagents for organic synthesis reactions.
preparation method: the corresponding common preparation method is obtained by bromination of pyridine compounds and then aminolysis.
Safety information: It is less toxic, but it still needs to be handled properly. Wear appropriate protective equipment to avoid contact with skin and eyes during use or operation. If exposed, rinse immediately with water and seek medical help. At the same time, the safe handling of chemicals should be observed, and stored in a dry, ventilated place, away from heat and flame.
1. Appearance: colorless crystal or white crystalline powder.
2. molecular formula: C5H5BrN2O
3. Molecular weight: 174.01g/mol
4. melting point: 135-139 degrees Celsius
5. solubility: slightly soluble in water, soluble in organic solvents.
The main uses of the pill include:
1. pesticide: as an intermediate of pesticides and herbicides.
2. drugs: intermediates for the synthesis of antimalarial drugs and other drugs.
3. Other applications: catalysts and complexing reagents for organic synthesis reactions.
preparation method: the corresponding common preparation method is obtained by bromination of pyridine compounds and then aminolysis.
Safety information: It is less toxic, but it still needs to be handled properly. Wear appropriate protective equipment to avoid contact with skin and eyes during use or operation. If exposed, rinse immediately with water and seek medical help. At the same time, the safe handling of chemicals should be observed, and stored in a dry, ventilated place, away from heat and flame.
Last Update：2024-04-09 21:11:58
Supplier List
Product Name: 2-AMINO-6-BROMOPYRIDIN-3-OL Visit Supplier Webpage Request for quotation
CAS: 934758-27-7
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 934758-27-7
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: 2-AMINO-6-BROMOPYRIDIN-3-OL Visit Supplier Webpage Request for quotation
CAS: 934758-27-7
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 934758-27-7
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History