2-Amino-9,9-dimethylfluorene
2-Amino-9,9-dimethylfluorene
CAS: 108714-73-4
Molecular Formula: C15H15N
2-Amino-9,9-dimethylfluorene - Names and Identifiers
| Name | 2-Amino-9,9-dimethylfluorene |
| Synonyms | 2-Amino-9,9-dimethyl 2-AMINO-9,9-DIMETHYLFLUORENE 2-Amino-9,9-dimethylfluorene 2-Amino-9,9'-Dimethylfluorene Fluoren-2-amine,9,9-dimethyl- 9,9-Dimethyl-9H-fluoren-2-amine 9H-Fluoren-2-amine,9,9-dimethyl- 2-Amino-9,9-dimethyl-9H-fluorene 2-AMino-9,9-diMethylfluorene,9,9-diMethyl-2-AMinofluorene |
| CAS | 108714-73-4 |
| EINECS | 805-747-3 |
| InChI | InChI=1/C15H15N/c1-15(2)13-6-4-3-5-11(13)12-8-7-10(16)9-14(12)15/h3-9H,16H2,1-2H3 |
| InChIKey | GUTJITRKAMCHSD-UHFFFAOYSA-N |
2-Amino-9,9-dimethylfluorene - Physico-chemical Properties
| Molecular Formula | C15H15N |
| Molar Mass | 209.29 |
| Density | 1.107 |
| Melting Point | 166.0 to 170.0 °C |
| Boling Point | 374.2±21.0 °C(Predicted) |
| Flash Point | 194.3°C |
| Vapor Presure | 8.46E-06mmHg at 25°C |
| Appearance | Powder |
| Color | Off-white |
| pKa | 4.35±0.40(Predicted) |
| Storage Condition | Keep in dark place,Inert atmosphere,Room temperature |
| Refractive Index | 1.631 |
2-Amino-9,9-dimethylfluorene - Reference Information
| Use | 2-amino -9, 9-dimethylfluorene is a useful research chemical for organic synthesis and other chemical processes. 2-amino -9, 9-dimethylfluorene is used as an intermediate for pharmaceutical, organic and optoelectronic materials. |
Last Update：2024-04-10 22:29:15
