2-BROMO-4-CHLORO-6-FLUOROPHENOL
2-Bromo-4-chloro-6-fluorophenol
CAS: 886499-88-3
Molecular Formula: C6H3BrClFO
2-BROMO-4-CHLORO-6-FLUOROPHENOL - Names and Identifiers
| Name | 2-Bromo-4-chloro-6-fluorophenol |
| Synonyms | 2-BROMO-4-CHLORO-6-FLUOROPHENOL 2-Bromo-4-chloro-6-fluorophenol Phenol, 2-bromo-4-chloro-6-fluoro- |
| CAS | 886499-88-3 |
| InChI | InChI=1S/C6H3BrClFO/c7-4-1-3(8)2-5(9)6(4)10/h1-2,10H |
2-BROMO-4-CHLORO-6-FLUOROPHENOL - Physico-chemical Properties
| Molecular Formula | C6H3BrClFO |
| Molar Mass | 225.44 |
| Density | 1.875±0.06 g/cm3(Predicted) |
| Boling Point | 205.3±35.0 °C(Predicted) |
| pKa | 6.74±0.23(Predicted) |
| Storage Condition | Inert atmosphere,Room Temperature |
| Refractive Index | 1.5820 |
2-BROMO-4-CHLORO-6-FLUOROPHENOL - Introduction
It is an organic compound with the chemical formula C6H3BrClF(OH). The following is a description of the properties, uses, methods of manufacture and safety information:
Nature:
1. Appearance: colorless or yellowish solid.
2. Solubility: Soluble in organic solvents such as ethanol, ether and chloroform, insoluble in water.
3. Melting point: about 70-72°C.
4. odor: has a special smell.
Use:
1. chemical synthesis: it can be used as an intermediate in organic synthesis and used in the preparation of other organic compounds.
2. fungicide: has certain antibacterial and fungicidal activity, can be used for agricultural pesticides and fungicides.
Preparation Method:
is generally obtained from the reaction of p-bromo-chlorophenol and fluoride. The specific preparation method can be improved and optimized according to actual needs.
Safety Information:
1. Toxicity: It belongs to organic compounds and has certain toxicity. Care should be taken to avoid direct contact with the skin and inhalation of its vapors during operation.
2. Burning and explosion: the compound can burn at high temperature and produce toxic gas.
3. Storage: Store it in a dry, well-ventilated place, away from fire and high temperature.
Summary:
is an organic compound that can be used as an intermediate in organic synthesis and as a fungicide. In the use and storage process, should pay attention to the relevant safety matters.
Nature:
1. Appearance: colorless or yellowish solid.
2. Solubility: Soluble in organic solvents such as ethanol, ether and chloroform, insoluble in water.
3. Melting point: about 70-72°C.
4. odor: has a special smell.
Use:
1. chemical synthesis: it can be used as an intermediate in organic synthesis and used in the preparation of other organic compounds.
2. fungicide: has certain antibacterial and fungicidal activity, can be used for agricultural pesticides and fungicides.
Preparation Method:
is generally obtained from the reaction of p-bromo-chlorophenol and fluoride. The specific preparation method can be improved and optimized according to actual needs.
Safety Information:
1. Toxicity: It belongs to organic compounds and has certain toxicity. Care should be taken to avoid direct contact with the skin and inhalation of its vapors during operation.
2. Burning and explosion: the compound can burn at high temperature and produce toxic gas.
3. Storage: Store it in a dry, well-ventilated place, away from fire and high temperature.
Summary:
is an organic compound that can be used as an intermediate in organic synthesis and as a fungicide. In the use and storage process, should pay attention to the relevant safety matters.
Last Update：2024-04-10 22:29:15
