2-Borono-5-bromo-p-xylene

2-Borono-5-bromo-p-xylene - Names and Identifiers

Name	4-Bromo-2,5-dimethylphenylboronic acid
Synonyms	AKOS BRN-0722 2-Borono-5-bromo-p-xylene 4-Bromo-2,5-Dimethylphenylboro 4-Bromo-2,5-dimethylphenylboronic acid 4-BROMO-2,5-DIMETHYLPHENYLBORONIC ACID 4-Bromo-2,5-dimethylbenzeneboronic acid (4-Bromo-2,5-dimethyphenyl)boronic acid Boronic acid, B-(4-bromo-2,5-dimethylphenyl)-
CAS	130870-00-7
InChI	InChI=1/C8H10BBrO2/c1-5-4-8(10)6(2)3-7(5)9(11)12/h3-4,11-12H,1-2H3

2-Borono-5-bromo-p-xylene - Physico-chemical Properties

Molecular Formula	C8H10BBrO2
Molar Mass	228.88
Density	1.50±0.1 g/cm3(Predicted)
Melting Point	194-202℃
Boling Point	350.3±52.0 °C(Predicted)
Flash Point	165.6°C
Vapor Presure	1.66E-05mmHg at 25°C
pKa	8.44±0.58(Predicted)
Storage Condition	Inert atmosphere,2-8°C
Refractive Index	1.574
Physical and Chemical Properties	Storage Conditions: Keep Cold

2-Borono-5-bromo-p-xylene - Risk and Safety

Hazard Symbols	Xi - Irritant
Hazard Class	IRRITANT, KEEP COLD

2-Borono-5-bromo-p-xylene - Introduction

4-Bromo-2, 5-dimethylbenzeneboronic acid is an organic compound with the chemical formula C9H11BrBO2. The following is a description of its nature, use, formulation and safety information:

Nature:
1. Appearance: 4-bromo -2,5-dimethylphenylboronic acid is white to light yellow crystalline or solid.
2. relative density: 1.44g/cm³.
3. melting point: about 235-236 ℃.

Use:
1. As an important intermediate in organic synthesis, it can be used to synthesize a series of compounds with biological activity.
2. In organic synthesis, it can play an important role as a catalyst or ligand.

Preparation Method:
The preparation method of 4-bromo-2, 5-dimethylphenylboronic acid can generally be achieved by the following steps:
1. react 2,5-dimethylphenylmagnesium bromide (2, bromide) with triphenylphosphine dichloromethanesulfonate (chloromethyl phenyl sulfonyl triphenylphosphine) to generate tetraphenylbromobenzene boronic acid intermediate.
2. The intermediate is reacted with hydrochloric acid to generate 4-bromo-2, 5-dimethylphenylboronic acid.

Safety Information:
When handling 4-bromo-2, 5-dimethylphenylboronic acid, the following safety precautions should be taken:
1. Avoid direct contact with skin and eyes, because it may cause irritation to skin and eyes.
2. use should wear appropriate personal protective equipment, such as gloves and protective glasses.
3. in the process of operation and storage should pay attention to fire prevention and avoid smoke and dust.
4. Storage should be placed in a closed container, away from fire and oxidant.

Last Update：2024-04-10 22:29:15