2-Bromo-3.5-dichloropyrazine
3-Amino-6-chloropyrazine-2-carbonitrile
CAS: 1206249-40-2
Molecular Formula: C4HBrCl2N2
2-Bromo-3.5-dichloropyrazine - Names and Identifiers
| Name | 3-Amino-6-chloropyrazine-2-carbonitrile |
| Synonyms | 2-Bromo-3.5-dichloropyrazine 2-BroMo-3.5-dichloropyrazine 2-bromo-3,5-dichloropyrazine 2-Bromo-3,5-dichloro-pyrazine Pyrazine, 2-bromo-3,5-dichloro- 2-amino-5-chloro-3-cyanopyrazine 3-Amino-6-chloropyrazine-2-carbonitrile |
| CAS | 1206249-40-2 |
| InChI | InChI=1S/C5H3ClN4/c6-4-2-9-5(8)3(1-7)10-4/h2H,(H2,8,9) |
2-Bromo-3.5-dichloropyrazine - Physico-chemical Properties
| Molecular Formula | C4HBrCl2N2 |
| Molar Mass | 227.87 |
| Density | 1.964±0.06 g/cm3(Predicted) |
| Boling Point | 242.0±35.0 °C(Predicted) |
| pKa | -6.55±0.10(Predicted) |
| Storage Condition | under inert gas (nitrogen or Argon) at 2-8°C |
| MDL | MFCD14581976 |
2-Bromo-3.5-dichloropyrazine - Introduction
2-Bromo-3, 5-dichloropyrazine, chemical formula C5H2BrCl2N, is an organic compound. The following is a description of its nature, use, formulation and safety information:
Nature:
1. Appearance and physical state: 2-bromo -3,5-dichloropyrazine is colorless or slightly yellow crystal.
2. Solubility: It is soluble in some organic solvents, such as ethers and alcohols, but has low solubility in water.
3. melting point: its melting point is between 110-113 ℃.
4. Stability: 2-bromo-3, 5-dichloropyrazine is relatively stable at room temperature.
Use:
Because 2-bromo-3, 5-dichloropyrazine has certain activity, it has some uses in the chemical and pharmaceutical fields. For example:
1. It can be used as a reagent for organic synthesis reactions to produce other organic compounds. In the field of medicine, it may be used to synthesize new drugs or as intermediates of drugs.
Method:
The preparation method of 2-bromo-3, 5-dichloropyrazine includes the following steps:
1. First, the precursor compound of pyrazine is synthesized through an appropriate chemical reaction.
2. Next, in the prepared precursor compound, a compound of bromine and chlorine is added to it to produce the desired 2-bromo-3, 5-dichloropyrazine.
3. Finally, the pure 2-bromo-3, 5-dichloropyrazine product was obtained through crystallization and purification steps.
Safety Information:
When using 2-bromo-3, 5-dichloropyrazine, the following safety precautions should be paid attention:
1. It is an organic compound, so it needs to be operated in a well-ventilated place to avoid inhaling its vapor or dust.
2. in contact, should avoid direct contact with the skin and eyes, if necessary, wear appropriate protective gloves and glasses.
3.2-Bromo-3, 5-dichloropyrazine may have certain toxicity to the environment, and should be avoided to the environment such as water sources.
Before use, please carefully read and follow the safety data sheet and operating instructions of the relevant chemical.
Nature:
1. Appearance and physical state: 2-bromo -3,5-dichloropyrazine is colorless or slightly yellow crystal.
2. Solubility: It is soluble in some organic solvents, such as ethers and alcohols, but has low solubility in water.
3. melting point: its melting point is between 110-113 ℃.
4. Stability: 2-bromo-3, 5-dichloropyrazine is relatively stable at room temperature.
Use:
Because 2-bromo-3, 5-dichloropyrazine has certain activity, it has some uses in the chemical and pharmaceutical fields. For example:
1. It can be used as a reagent for organic synthesis reactions to produce other organic compounds. In the field of medicine, it may be used to synthesize new drugs or as intermediates of drugs.
Method:
The preparation method of 2-bromo-3, 5-dichloropyrazine includes the following steps:
1. First, the precursor compound of pyrazine is synthesized through an appropriate chemical reaction.
2. Next, in the prepared precursor compound, a compound of bromine and chlorine is added to it to produce the desired 2-bromo-3, 5-dichloropyrazine.
3. Finally, the pure 2-bromo-3, 5-dichloropyrazine product was obtained through crystallization and purification steps.
Safety Information:
When using 2-bromo-3, 5-dichloropyrazine, the following safety precautions should be paid attention:
1. It is an organic compound, so it needs to be operated in a well-ventilated place to avoid inhaling its vapor or dust.
2. in contact, should avoid direct contact with the skin and eyes, if necessary, wear appropriate protective gloves and glasses.
3.2-Bromo-3, 5-dichloropyrazine may have certain toxicity to the environment, and should be avoided to the environment such as water sources.
Before use, please carefully read and follow the safety data sheet and operating instructions of the relevant chemical.
Last Update：2024-04-09 21:01:54
Supplier List
Product Name: 2-Bromo-3,5-dichloropyrazine Visit Supplier Webpage Request for quotation
CAS: 1206249-40-2
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 1206249-40-2
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: 2-Bromo-3,5-dichloropyrazine Visit Supplier Webpage Request for quotation
CAS: 1206249-40-2
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 1206249-40-2
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History