2-Heptyl-5-mercapto-1,3,4-oxadiazole
5-heptyl-1,3,4-oxadiazole-2(3H)-thione
CAS: 66473-10-7
Molecular Formula: C9H16N2OS
2-Heptyl-5-mercapto-1,3,4-oxadiazole - Names and Identifiers
| Name | 5-heptyl-1,3,4-oxadiazole-2(3H)-thione |
| Synonyms | Einecs 266-377-0 2-HEPTYL-5-MERCAPTO OXIDIAZOLE 5-Heptyl-2-mercapto-1,3,4-oxadiazole 5-HEPTYL-1,3,4-OXADIAZOLINE-2-THIONE 4-oxadiazole-2(3h)-thione,5-heptyl-3 5-HEPTYL-2-MERCAPTO-1,3,4-OXADIAZOLE 2-Heptyl-5-mercapto-1,3,4-oxadiazole 5-heptyl-1,3,4-oxadiazole-2(3H)-thione 3,4-Oxadiazole-2(3H)-thione,5-heptyl-1 2-(1-HEPTYL)-5-MERCAPTO 1,3,4-OXODIAZOLE |
| CAS | 66473-10-7 |
| EINECS | 266-377-0 |
| InChI | InChI=1/C9H16N2OS/c1-2-3-4-5-6-7-8-10-11-9(13)12-8/h2-7H2,1H3,(H,11,13) |
2-Heptyl-5-mercapto-1,3,4-oxadiazole - Physico-chemical Properties
| Molecular Formula | C9H16N2OS |
| Molar Mass | 200.3 |
| Density | 1.16±0.1 g/cm3(Predicted) |
| Boling Point | 247.4±23.0 °C(Predicted) |
| Flash Point | 103.4°C |
| Vapor Presure | 0.0258mmHg at 25°C |
| pKa | 4.86±0.70(Predicted) |
| Refractive Index | 1.563 |
2-Heptyl-5-mercapto-1,3,4-oxadiazole - Risk and Safety
| UN IDs | 2811 |
| Hazard Class | 6.1(a) |
| Packing Group | I |
2-Heptyl-5-mercapto-1,3,4-oxadiazole - Reference Information
| EPA chemical substance information | information is provided by: ofmpeb.epa.gov (external link) |
Last Update：2024-04-09 15:16:52
