2-Phenyl-2-oxoethanamine
2-amino-1-phenylethan-1-one
CAS: 613-89-8
Molecular Formula: C8H9NO
2-Phenyl-2-oxoethanamine - Names and Identifiers
| Name | 2-amino-1-phenylethan-1-one |
| Synonyms | Phenacylamine Methylcathinon 2-Aminoacetophenone 2-Aminoecetophenone a-Aminoacetophenone alpha-Aminoacetophenone 2-Phenyl-2-oxoethanamine 2-amino-1-phenylethan-1-one 2-Amino-1-phenyl-1-ethanone |
| CAS | 613-89-8 |
| EINECS | 210-358-1 |
| InChI | InChI=1/C8H9NO/c9-6-8(10)7-4-2-1-3-5-7/h1-5H,6,9H2 |
2-Phenyl-2-oxoethanamine - Physico-chemical Properties
| Molecular Formula | C8H9NO |
| Molar Mass | 135.16 |
| Density | 1.118 |
| Melting Point | 20°C |
| Boling Point | 97-99@1mm |
| Flash Point | 112°C |
| pKa | 7.50±0.29(Predicted) |
| Refractive Index | 1.6160 (estimate) |
2-Phenyl-2-oxoethanamine - Reference Information
| Use | 2-Aminoacetophenone is a ketone organic substance, which can be used as a reagent for detecting acetoacetic acid and also used in organic synthesis. |
| category | toxic substances |
| toxicity classification | highly toxic |
| acute toxicity | reference value: oral administration-rat LD50: 381 mg/kg; Oral administration-mouse LD50: 596 mg/kg |
| flammability hazard characteristics | combustible; combustion produces toxic nitrogen oxide smoke |
| storage and transportation characteristics | warehouse ventilation and low temperature drying |
| fire extinguishing agent | dry powder, foam, sand, carbon dioxide, mist water |
Last Update：2024-04-09 20:49:11
